CAS 395104-30-0

3-[3-[2-(1-Piperidinyl)ethoxy]phenyl]-5-(1H-1,2,4-triazol-5-yl)-1H-indazole

Description:

3-[3-[2-(1-Piperidinyl)ethoxy]phenyl]-5-(1H-1,2,4-triazol-5-yl)-1H-indazole, with CAS number 395104-30-0, is a synthetic organic compound characterized by its complex molecular structure, which includes an indazole core, a triazole moiety, and a piperidine substituent. This compound exhibits properties typical of small organic molecules, such as moderate solubility in organic solvents and potential bioactivity due to its diverse functional groups. The presence of the piperidine ring suggests potential interactions with biological targets, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its structure may confer specific pharmacological properties, including potential anti-inflammatory or anti-cancer activities, although detailed biological data would be necessary to confirm such effects. Additionally, the compound's stability, reactivity, and interaction with other substances would depend on environmental conditions such as pH and temperature. Overall, this compound represents a class of heterocyclic compounds that are often explored for their therapeutic potential.

Formula: C₂₂H₂₄N₆O

InChI: InChI=1S/C22H24N6O/c1-2-9-28(10-3-1)11-12-29-18-6-4-5-16(13-18)21-19-14-17(22-23-15-24-27-22)7-8-20(19)25-26-21/h4-8,13-15H,1-3,9-12H2,(H,25,26)(H,23,24,27)

SMILES: C1CCN(CC1)CCOc1cccc(c1)c1c2cc(ccc2[nH]n1)c1nc[nH]n1

CC-401

CAS: 395104-30-0

CC-401 is a specific inhibitor of JNK (Ki: 25-50nM).

Formula: C₂₂H₂₄N₆O

Purity: 98%

Color and Shape: Solid

Molecular weight: 388.47

Ref: TM-T22639

CC-401 hydrochloride

CAS: 395104-30-0

Ref: 7W-GW5918

Cc-401

CAS: 395104-30-0

Cc-401

Molecular weight: 388.46556g/mol

Ref: 54-BISN0256