CAS 39515-47-4
:α-Cyano-3-phenoxybenzyl alcohol
Description:
α-Cyano-3-phenoxybenzyl alcohol, identified by its CAS number 39515-47-4, is a chemical compound characterized by its structural features, which include a cyano group and a phenoxybenzyl moiety. This compound typically exhibits a white to off-white crystalline appearance. It is known for its role as an intermediate in organic synthesis and may possess biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. The presence of the cyano group contributes to its reactivity, allowing for potential transformations in synthetic applications. Additionally, the phenoxy group can influence the compound's solubility and interaction with biological systems. As with many organic compounds, α-Cyano-3-phenoxybenzyl alcohol's properties, such as melting point, boiling point, and solubility, can vary based on environmental conditions and purity. Safety data should be consulted for handling and usage, as it may pose health risks if not managed properly. Overall, this compound serves as a valuable building block in chemical research and development.
Formula:C14H11NO2
InChI:InChI=1S/C14H11NO2/c15-10-14(16)11-5-4-8-13(9-11)17-12-6-2-1-3-7-12/h1-9,14,16H
InChI key:InChIKey=GXUQMKBQDGPMKZ-UHFFFAOYSA-N
SMILES:O(C1=CC(C(C#N)O)=CC=C1)C2=CC=CC=C2
Synonyms:- 3-Phenoxy-α-cyanobenzyl alcohol
- α-Cyano-m-phenoxybenzyl alcohol
- α-Hydroxy-3-phenoxybenzeneacetonitrile
- 3-Phenoxybenzaldehyde cyanohydrin
- Benzeneacetonitrile, α-hydroxy-3-phenoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2-Hydroxy-2-(3-phenoxyphenyl)acetonitrile
CAS:Formula:C14H11NO2Purity:95%Color and Shape:LiquidMolecular weight:225.24263-Phenoxybenzaldehyde cyanohydrin
CAS:3-Phenoxybenzaldehyde cyanohydrinPurity:≥95%Molecular weight:225.24g/mol3-Phenoxybenzaldehyde cyanohydrin
CAS:3-Phenoxybenzaldehyde cyanohydrin (2-Hydroxy-2-(3-phenoxyphenyl)acetonitrile) is an intermediate of pyrethroid insecticides such as fenpermethrin.Formula:C14H11NO2Purity:99.60%Color and Shape:SolidMolecular weight:225.242-Hydroxy-2-(3-phenoxyphenyl)acetonitrile
CAS:<p>2-Hydroxy-2-(3-phenoxyphenyl)acetonitrile is an organic compound that is synthesized by the reaction of 3-phenoxybenzaldehyde with nitrous acid in aqueous solution. This compound can be racemized by the enzyme lipase and esterified to form an ester linkage. 2-Hydroxy-2-(3-phenoxyphenyl)acetonitrile has been shown to exhibit insecticidal activity against various strains of bacteria, including Bacillus subtilis, Staphylococcus aureus, and Escherichia coli. 2HPA is a pyrethroid insecticide that has been shown to inhibit lipid synthesis by binding to phospholipids in the bacterial cell membrane. This inhibits the production of fatty acids and glycerol phosphate, inhibiting the growth of the bacteria.</p>Formula:C14H11NO2Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:225.24 g/mol2-Hydroxy-2-(3-phenoxyphenyl)acetonitrile
CAS:Formula:C14H11NO2Purity:95%Color and Shape:LiquidMolecular weight:225.247α-Hydroxy-3-phenoxybenzeneacetonitrile (>90%)
CAS:Controlled ProductFormula:C14H11NO2Purity:>90%Color and Shape:NeatMolecular weight:225.24






