CAS 3952-78-1
:Alizarin complexone
Description:
Alizarin complexone, with the CAS number 3952-78-1, is a chelating agent known for its ability to form stable complexes with metal ions. It is derived from alizarin, a natural dye, and is characterized by its ability to selectively bind to various transition metals, making it useful in analytical chemistry and environmental applications. The compound typically exhibits a bright color, which can vary depending on the metal ion it complexes with, and is often used in colorimetric assays. Alizarin complexone is soluble in water and organic solvents, enhancing its versatility in different chemical environments. Its chelating properties make it valuable in applications such as metal ion extraction, water treatment, and as a reagent in various chemical analyses. Additionally, it has potential uses in biological systems, where it can influence metal ion availability and bioactivity. Overall, alizarin complexone is a significant compound in both industrial and research settings due to its effective metal-binding capabilities.
Formula:C19H15NO8
InChI:InChI=1S/C19H15NO8/c21-13(22)7-20(8-14(23)24)6-9-5-12-15(19(28)16(9)25)18(27)11-4-2-1-3-10(11)17(12)26/h1-5,25,28H,6-8H2,(H,21,22)(H,23,24)
InChI key:InChIKey=PWIGYBONXWGOQE-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)C=3C1=CC=CC3)=CC(CN(CC(O)=O)CC(O)=O)=C(O)C2O
Synonyms:- (3,4-Dihydroxy-2-anthraquinonyl)methyliminodiacetic acid dihydrate
- 1,2-Dihydroxyanthraquinone-3-methylamine-N,N-diacetic acid
- 2,2'-{[(3,4-Dihydroxy-9,10-Dioxo-9,10-Dihydroanthracen-2-Yl)Methyl]Imino}Diacetic Acid
- 2,2′-(((3,4-Dihydroxy-9,10-dioxo-9,10-dihydroanthracen-2-yl)methyl)azanediyl)diacetic acid
- 2-[Carboxymethyl-[(3,4-dihydroxy-9,10-dioxoanthracen-2-yl)methyl]amino]acetic acid
- 3-Aminomethylalizarin-N,N-diacetic acid
- 3-Aminomethylalizarin-NN-diacetic acid
- Acetic acid, [[(3,4-dihydroxy-2-anthraquinonyl)methyl]imino]di-
- Alizarin complexan
- Alizarin complexon
- Alizarin complexone
- Alizarin fluorine blue
- Alizarin-3-methyliminodiacetic acid
- Alizarine Complexone
- Alizarine Fluorine Blue
- Alizarine complexan
- Alizarine complexon
- Glycine, N-(carboxymethyl)-N-[(9,10-dihydro-3,4-dihydroxy-9,10-dioxo-2-anthracenyl)methyl]-
- N-(3,4-Dihydroxy-2-anthraquinonylmethyl)iminodiacetic acid
- N-(Carboxymethyl)-N-[(9,10-dihydro-3,4-dihydroxy-9,10-dioxo-2-anthracenyl)methyl]glycine
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Alizarin Complexone
CAS:Formula:C19H15NO8Purity:>70.0%(HPLC)Color and Shape:Orange to Amber to Dark red powder to crystalMolecular weight:385.33Alizarin Complexone, may cont. up to 10% water
CAS:Alizarin is the main ingredient for the manufacture of the madder lake pigments known to painters as Rose madder and Alizarin crimson. A notable use of alizarin in modern times is as a staining agent in biological research because it stains free calcium and certain calcium compounds a red or lightFormula:C19H15NO8Color and Shape:Orange to brown, powderMolecular weight:385.33Glycine,N-(carboxymethyl)-N-[(9,10-dihydro-3,4-dihydroxy-9,10-dioxo-2-anthracenyl)methyl]-
CAS:Formula:C19H15NO8Purity:98%Color and Shape:SolidMolecular weight:385.3243Alizarin Complexone
CAS:Formula:C19H15NO8Purity:≥ 97.0% (anhydrous basis)Color and Shape:Yellow, orange or brown powderMolecular weight:385.33Alizarin-3-methyliminodiacetic acid
CAS:Alizarin-3-methyliminodiacetic acidPurity:95%Molecular weight:385.32g/mol2,2'-(((3,4-Dihydroxy-9,10-dioxo-9,10-dihydroanthracen-2-yl)methyl)azanediyl)diacetic acid
CAS:Purity:97.0%Molecular weight:385.3280029296875Alizarin Complexone
CAS:Alizarin Complexone (Alizarin-3-methyliminodiacetic acid) is an inhibitor of Rous-associated virus 2 reverse transcriptase.Formula:C19H15NO8Purity:98.97%Color and Shape:Red To Brown PowderMolecular weight:385.32






