CAS 39524-13-5

HN-saponin F

Description:

HN-saponin F, with the CAS number 39524-13-5, is a type of saponin, which is a class of chemical compounds known for their surfactant properties. Saponins are glycosides that typically consist of a hydrophobic aglycone (sapogenin) and one or more hydrophilic sugar moieties. HN-saponin F is derived from natural sources, often found in plants, and is characterized by its ability to form stable foams and emulsions, making it useful in various applications, including pharmaceuticals, cosmetics, and food products. Its surfactant properties can enhance the solubility of other compounds, facilitating their absorption in biological systems. Additionally, saponins are known for their potential health benefits, including antimicrobial and anti-inflammatory effects. However, they can also exhibit toxicity at high concentrations, which necessitates careful consideration in their use. Overall, HN-saponin F exemplifies the diverse roles that saponins play in both nature and industry, highlighting their significance in various fields of research and application.

Formula: C₄₁H₆₆O₁₃

InChI: InChI=1S/C41H66O13/c1-36(2)13-15-41(35(50)54-34-32(49)30(47)29(46)24(18-42)52-34)16-14-39(5)21(22(41)17-36)7-8-26-37(3)11-10-27(53-33-31(48)28(45)23(44)19-51-33)38(4,20-43)25(37)9-12-40(26,39)6/h7,22-34,42-49H,8-20H2,1-6H3/t22-,23-,24+,25+,26+,27-,28-,29+,30-,31+,32+,33-,34-,37-,38-,39+,40+,41-/m0/s1

InChI key: InChIKey=UCVNVSOIAFGLPL-UUWFFIQNSA-N

SMILES: C(O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)(=O)[C@]23[C@](C=4[C@@](C)(CC2)[C@@]5(C)[C@](CC4)([C@]6(C)[C@@](CC5)([C@@](CO)(C)[C@@H](O[C@H]7[C@H](O)[C@@H](O)[C@@H](O)CO7)CC6)[H])[H])(CC(C)(C)CC3)[H]

Synonyms:

• 3-O-α-L-Arabinopyranosylhederagenin 28-β-D-glucopyranoside
• HN-saponin F
• Hedera nepalensis saponin F
• Olean-12-en-28-oic acid, 3-(α-L-arabinopyranosyloxy)-23-hydroxy-, β-D-glucopyranosyl ester, (3β,4α)-
• Pulsatilla saponin B

HN Saponin F

CAS: 39524-13-5

HN Saponin F is a useful organic compound for research related to life sciences. The catalog number is T124904 and the CAS number is 39524-13-5.

Formula: C₄₁H₆₆O₁₃

Color and Shape: Solid

Molecular weight: 766.966

Ref: TM-T124904