CymitQuimica logo

CAS 39539-67-8

:

6-(methylsulfanyl)pyridazin-3-amine

Description:
6-(Methylsulfanyl)pyridazin-3-amine is a chemical compound characterized by its pyridazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of a methylsulfanyl group (-S-CH3) at the 6-position and an amino group (-NH2) at the 3-position contributes to its unique reactivity and potential biological activity. This compound may exhibit properties such as being a potential ligand in medicinal chemistry, where modifications to the pyridazine structure can influence its pharmacological profile. The methylsulfanyl group can enhance lipophilicity, potentially affecting the compound's solubility and permeability. Additionally, the amino group can participate in hydrogen bonding, which may be relevant in interactions with biological targets. The compound's molecular structure suggests it could be of interest in the development of pharmaceuticals, particularly in areas related to anti-inflammatory or antimicrobial agents. As with many heterocyclic compounds, its synthesis and characterization would involve standard organic chemistry techniques, and its properties would be further elucidated through spectroscopic methods.
Formula:C5H7N3S
InChI:InChI=1/C5H7N3S/c1-9-5-3-2-4(6)7-8-5/h2-3H,1H3,(H2,6,7)
SMILES:CSc1ccc(=N)[nH]n1
Synonyms:
  • 3-Pyridazinamine, 6-(Methylthio)-
  • 6-(Methylsulfanyl)-3-pyridazinamine
  • 6-(Methylsulfanyl)pyridazin-3-amin
  • 6-(Methylsulfanyl)pyridazin-3-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.