CAS 3956-73-8: N1,N1,N4,N4-Tetrakis[4-(diethylamino)phenyl]-1,4-benzenediamine
Description:N1,N1,N4,N4-Tetrakis[4-(diethylamino)phenyl]-1,4-benzenediamine, commonly referred to as TDA, is an organic compound characterized by its complex structure featuring multiple diethylamino groups attached to a central benzene ring. This compound is known for its vibrant color and is often utilized in dye chemistry, particularly in the synthesis of various azo dyes and pigments. Its molecular structure contributes to its properties as a strong electron donor, making it useful in applications such as organic electronics and photonic devices. TDA exhibits good solubility in organic solvents, which enhances its utility in various formulations. Additionally, it may possess interesting photophysical properties, including fluorescence, which can be exploited in sensor technologies. However, safety considerations are important, as compounds with amine functionalities can be hazardous, necessitating proper handling and disposal protocols. Overall, TDA is a significant compound in the field of organic chemistry, particularly in the development of colorants and electronic materials.
Formula:C46H60N6
InChI:InChI=1S/C46H60N6/c1-9-47(10-2)37-17-25-41(26-18-37)51(42-27-19-38(20-28-42)48(11-3)12-4)45-33-35-46(36-34-45)52(43-29-21-39(22-30-43)49(13-5)14-6)44-31-23-40(24-32-44)50(15-7)16-8/h17-36H,9-16H2,1-8H3
InChI key:InChIKey=CEASIDDAJACXTG-UHFFFAOYSA-N
SMILES:C=1C=C(C=CC1N(C2=CC=C(C=C2)N(CC)CC)C3=CC=C(C=C3)N(CC)CC)N(C4=CC=C(C=C4)N(CC)CC)C5=CC=C(C=C5)N(CC)CC
- Synonyms:
- 1,4-Benzenediamine, N,N,N',N'-tetrakis(4-(diethylamino)phenyl)-
- 1,4-Benzenediamine, N1,N1,N4,N4-tetrakis(4-(diethylamino)phenyl)-
- 1,4-Benzenediamine, N<sup>1</sup>,N<sup>1</sup>,N<sup>4</sup>,N<sup>4</sup>-tetrakis[4-(diethylamino)phenyl]-
- N,N,N′,N′-Tetrakis[p-(diethylamino)phenyl]-1,4-phenylenediamine
- N<sup>1</sup>,N<sup>1</sup>,N<sup>4</sup>,N<sup>4</sup>-Tetrakis[4-(diethylamino)phenyl]-1,4-benzenediamine
- N~1~,N~1~'-benzene-1,4-diylbis{N-[4-(diethylamino)phenyl]-N',N'-diethylbenzene-1,4-diamine}
- Tetrakis(p-diethylaminophenyl)-p-phenylenediamine
- p-Phenylenediamine, N,N,N′,N′-tetrakis[p-(diethylamino)phenyl]-
- N1,N1,N4,N4-Tetrakis[4-(diethylamino)phenyl]-1,4-benzenediamine
- N,N,N',N'-Tetrakis(4-(diethylamino)phenyl)benzene-1,4-diamine
- See more synonyms
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | NnN,N',N'-tetrakis[4-(diethylamino)phenyl]benzene-1,4-diamine REF: 3D-FN151826CAS: 3956-73-8 | Min. 95% | - - - | Discontinued product |

NnN,N',N'-tetrakis[4-(diethylamino)phenyl]benzene-1,4-diamine
Ref: 3D-FN151826
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |