CAS 39563-55-8

N-(2-phenylethyl)benzene-1,4-diamine

Description:

N-(2-phenylethyl)benzene-1,4-diamine, also known by its CAS number 39563-55-8, is an organic compound characterized by the presence of an amine functional group attached to a benzene ring. This compound features a phenylethyl group, which contributes to its aromatic properties and potential for various chemical interactions. It typically appears as a solid at room temperature and is soluble in organic solvents, reflecting its hydrophobic nature due to the aromatic rings. The presence of two amine groups allows for hydrogen bonding, which can influence its reactivity and interactions with other molecules. This compound may be of interest in various fields, including pharmaceuticals and materials science, due to its potential applications in drug development or as a building block in organic synthesis. Safety data should be consulted for handling and storage, as amines can be hazardous. Overall, N-(2-phenylethyl)benzene-1,4-diamine is a versatile compound with significant implications in chemical research and application.

Formula: C₁₄H₁₆N₂

InChI: InChI=1/C14H16N2/c15-13-6-8-14(9-7-13)16-11-10-12-4-2-1-3-5-12/h1-9,16H,10-11,15H2

SMILES: c1ccc(cc1)CCNc1ccc(cc1)N

Synonyms:

• N-Phenethyl-benzene-1,4-diamine

1-N-(2-Phenylethyl)benzene-1,4-diamine

CAS: 39563-55-8

Versatile small molecule scaffold

Formula: C₁₄H₁₆N₂

Purity: Min. 95%

Molecular weight: 212.29 g/mol

Ref: 3D-PBA56355