CAS 3958-83-6
:2-iodocyclohexa-2,5-diene-1,4-dione
Description:
2-Iodocyclohexa-2,5-diene-1,4-dione, with the CAS number 3958-83-6, is an organic compound characterized by its unique bicyclic structure featuring both iodine and dione functional groups. This compound contains a six-membered cyclohexadiene ring with two carbonyl (C=O) groups located at the 1 and 4 positions, contributing to its reactivity and potential applications in organic synthesis. The presence of the iodine atom at the 2-position enhances its electrophilic character, making it a useful intermediate in various chemical reactions, including nucleophilic substitutions and cycloadditions. The compound is typically a solid at room temperature and may exhibit distinct color properties due to its conjugated system. Its reactivity profile is influenced by the electron-withdrawing nature of the carbonyl groups and the halogen, which can facilitate further transformations in synthetic organic chemistry. Safety precautions should be taken when handling this compound, as iodine and carbonyl compounds can pose health risks.
Formula:C6H3IO2
InChI:InChI=1/C6H3IO2/c7-5-3-4(8)1-2-6(5)9/h1-3H
SMILES:C1=CC(=O)C(=CC1=O)I
Synonyms:- 2,5-Cyclohexadiene-1,4-Dione, 2-Iodo-
- 2-Iodo-1,4-benzoquinone
- Monoiodoquinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Iodo-1,4-benzoquinone
CAS:2-Iodo-1,4-benzoquinoneFormula:C6H3IO2Purity:TechColor and Shape: red crystalline powderMolecular weight:233.99g/mol
