CymitQuimica logo

CAS 39581-63-0

:

2,4,5,8-Tetramethylquinoline

Description:
2,4,5,8-Tetramethylquinoline is an organic compound belonging to the quinoline family, characterized by a bicyclic structure that includes a benzene ring fused to a pyridine ring. This compound features four methyl groups attached to the quinoline structure at the 2, 4, 5, and 8 positions, which significantly influence its physical and chemical properties. It is typically a yellow to brown liquid or solid, depending on the temperature and purity. The presence of multiple methyl groups enhances its hydrophobicity and may affect its solubility in various organic solvents. 2,4,5,8-Tetramethylquinoline exhibits fluorescence, making it of interest in various applications, including as a potential fluorescent probe in biochemical studies. Additionally, it may possess antioxidant properties, which could be relevant in pharmaceutical and industrial applications. As with many quinoline derivatives, it is essential to handle this compound with care due to potential toxicity and environmental impact. Always refer to safety data sheets and regulatory guidelines when working with such substances.
Formula:C13H15N
InChI:InChI=1/C13H15N/c1-8-5-6-9(2)13-12(8)10(3)7-11(4)14-13/h5-7H,1-4H3
SMILES:Cc1ccc(C)c2c1c(C)cc(C)n2
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.