CAS 396-15-6
:(4-fluoro-2-nitrophenoxy)acetic acid
Description:
(4-Fluoro-2-nitrophenoxy)acetic acid, with the CAS number 396-15-6, is an organic compound characterized by its aromatic structure and functional groups. It features a phenoxy group, which is a phenol derivative where a hydroxyl group is replaced by an acetic acid moiety, along with a fluoro and nitro substituent on the aromatic ring. This compound is typically a solid at room temperature and is soluble in organic solvents, reflecting its polar functional groups. The presence of the fluoro and nitro groups contributes to its reactivity and potential applications in various chemical syntheses and as an intermediate in pharmaceuticals or agrochemicals. Its acidity is attributed to the carboxylic acid group, which can participate in hydrogen bonding and influence its solubility and reactivity. Safety data should be consulted for handling, as compounds with nitro and fluoro groups can exhibit toxicity and environmental persistence. Overall, (4-fluoro-2-nitrophenoxy)acetic acid is a compound of interest in both research and industrial applications due to its unique chemical properties.
Formula:C8H6FNO5
InChI:InChI=1/C8H6FNO5/c9-5-1-2-7(15-4-8(11)12)6(3-5)10(13)14/h1-3H,4H2,(H,11,12)
SMILES:c1cc(c(cc1F)N(=O)=O)OCC(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
