CAS 396-30-5
:6-fluoroquinoline
Description:
6-Fluoroquinoline is a heterocyclic aromatic compound characterized by a fused bicyclic structure that includes a benzene ring and a pyridine ring. The presence of a fluorine atom at the 6-position of the quinoline ring system significantly influences its chemical properties and reactivity. This compound is typically a pale yellow to light brown liquid or solid, depending on its form and purity. It is known for its potential applications in medicinal chemistry, particularly as a scaffold for the development of antimicrobial and antiviral agents. The fluorine substituent can enhance lipophilicity and bioavailability, making it a valuable modification in drug design. Additionally, 6-fluoroquinoline exhibits fluorescence properties, which can be useful in various analytical applications. Its synthesis often involves the fluorination of quinoline derivatives or other synthetic routes that introduce the fluorine atom at the desired position. As with many fluorinated compounds, it is essential to handle 6-fluoroquinoline with care due to potential toxicity and environmental considerations.
Formula:C9H6FN
InChI:InChI=1/C9H6FN/c10-8-3-4-9-7(6-8)2-1-5-11-9/h1-6H
InChI key:InChIKey=RMDCSDVIVXJELQ-UHFFFAOYSA-N
SMILES:FC1=CC2=C(C=C1)N=CC=C2
Synonyms:- Brn 0112962
- Ccris 2892
- Quinoline, 6-fluoro-
- 6-Fluoroquinoline
- 6-Fluoroquinoline
- 6-Fluoroquinoine
- 6-Fluoroquinoline>
- 6-Fluoroquinolin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
6-Fluoroquinoline
CAS:Formula:C9H6FNPurity:>98.0%(GC)Color and Shape:Light yellow to Brown clear liquidMolecular weight:147.156-Fluoroquinoline, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C9H6FNPurity:97%Color and Shape:Clear colorless to yellow, LiquidMolecular weight:147.156-Fluoroquinoline
CAS:6-FluoroquinolineFormula:C9H6FNPurity:97%Color and Shape: yellow liquidMolecular weight:147.15g/mol6-Fluoroquinoline
CAS:Controlled ProductApplications 6-Fluoroquinoline, is a versatile building block used in the synthesis of various chemical compounds.
Formula:C9H6FNColor and Shape:NeatMolecular weight:147.15







