CAS 396105-43-4

4-(4-benzyl-1,4-diazepan-1-yl)-4-oxobutanoic acid

Description:

4-(4-benzyl-1,4-diazepan-1-yl)-4-oxobutanoic acid, with the CAS number 396105-43-4, is a chemical compound characterized by its unique structure that includes a diazepane ring and a ketone functional group. This compound features a benzyl substituent attached to the diazepane, which contributes to its potential biological activity. The presence of the carboxylic acid group indicates that it can participate in acid-base reactions and may exhibit polar characteristics, influencing its solubility in various solvents. The molecular structure suggests that it may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the diazepane moiety, which is often associated with psychoactive properties. Additionally, the compound's ability to form hydrogen bonds due to the carboxylic acid and the nitrogen atoms in the diazepane ring may enhance its interactions with biological targets. Overall, this compound's structural features suggest a potential for diverse chemical reactivity and biological activity, warranting further investigation in research and development contexts.

Formula: C₁₆H₂₂N₂O₃

InChI: InChI=1/C16H22N2O3/c19-15(7-8-16(20)21)18-10-4-9-17(11-12-18)13-14-5-2-1-3-6-14/h1-3,5-6H,4,7-13H2,(H,20,21)

SMILES: c1ccc(cc1)CN1CCCN(CC1)C(=O)CCC(=O)O

Synonyms:

• 1H-1,4-Diazepine-1-butanoic acid, hexahydro-gamma-oxo-4-(phenylmethyl)-
• 4-Benzyl-hexahydro-gamma-oxo-1,4-diazepine-1-butanoic acid
• 4-(4-Benzyl-1,4-diazepan-1-yl)-4-oxobutanoic acid

4-(4-Benzylhomopiperazin-1-yl)-4-oxobutanoic acid

CAS: 396105-43-4

4-(4-Benzylhomopiperazin-1-yl)-4-oxobutanoic acid

Purity: 95%

Molecular weight: 290.36g/mol

Ref: 54-OR7821