CAS 396129-93-4

2-Oxo-α-phenyl-1-piperidineacetic acid

Description:

2-Oxo-α-phenyl-1-piperidineacetic acid, with the CAS number 396129-93-4, is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features a phenyl group and a keto (oxo) functional group, contributing to its reactivity and potential biological activity. It is typically classified as an amino acid derivative due to the presence of both an acidic carboxylic acid group and an amine component within its structure. The compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its solubility, stability, and reactivity can vary depending on environmental conditions such as pH and temperature. Additionally, the presence of the phenyl group can influence its interactions with biological targets, potentially affecting its efficacy and safety profile. As with many organic compounds, proper handling and storage are essential to maintain its integrity and prevent degradation.

Formula: C₁₃H₁₅NO₃

InChI: InChI=1S/C13H15NO3/c15-11-8-4-5-9-14(11)12(13(16)17)10-6-2-1-3-7-10/h1-3,6-7,12H,4-5,8-9H2,(H,16,17)

InChI key: InChIKey=CQHQRANYGPPLRE-UHFFFAOYSA-N

SMILES: C(C(O)=O)(N1C(=O)CCCC1)C2=CC=CC=C2

Synonyms:

• 1-Piperidineacetic acid, 2-oxo-α-phenyl-
• 2-(2-Oxopiperidin-1-yl)-2-phenylacetic acid
• 2-Oxo-a-phenyl-1-piperidineacetic acid

2-(2-Oxopiperidin-1-yl)-2-phenylacetic acid

CAS: 396129-93-4

Versatile small molecule scaffold

Formula: C₁₃H₁₅NO₃

Purity: Min. 95%

Molecular weight: 233.26 g/mol

Ref: 3D-WQA12993