CAS 39621-11-9

6-(hydroxymethyl)pyridine-2-carbaldehyde

Description:

6-(Hydroxymethyl)pyridine-2-carbaldehyde, with the CAS number 39621-11-9, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a hydroxymethyl group (-CH2OH) and an aldehyde functional group (-CHO) attached to the pyridine ring, specifically at the 6 and 2 positions, respectively. The presence of these functional groups contributes to its reactivity and potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The hydroxymethyl group can participate in various chemical reactions, such as oxidation and condensation, while the aldehyde group is known for its reactivity in nucleophilic addition reactions. Additionally, this compound may exhibit biological activity, making it of interest in medicinal chemistry. Its solubility and stability can vary depending on the solvent and environmental conditions, which are important factors to consider in practical applications. Overall, 6-(hydroxymethyl)pyridine-2-carbaldehyde is a versatile compound with significant potential in various chemical and biological contexts.

Formula: C₇H₇NO₂

InChI: InChI=1/C7H7NO2/c9-4-6-2-1-3-7(5-10)8-6/h1-4,10H,5H2

SMILES: c1cc(C=O)nc(c1)CO

6-(Hydroxymethyl)pyridine-2-carboxaldehyde

CAS: 39621-11-9

Formula: C₇H₇NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 137.1360

Ref: IN-DA00C8CL

6-(Hydroxymethyl)pyridine-2-carboxaldehyde

CAS: 39621-11-9

6-(Hydroxymethyl)pyridine-2-carboxaldehyde

Formula: C₇H₇NO₂

Purity: ≥95%

Color and Shape: pale yellow solid

Molecular weight: 137.14g/mol

Ref: 54-OR59878

6-(Hydroxymethyl)pyridine-2-carboxaldehyde

CAS: 39621-11-9

6-(Hydroxymethyl)pyridine-2-carboxaldehyde is a ligand that has anisotropic magnetic properties. It crystallizes in an orthorhombic system, and its structure consists of two iron atoms (II) coordinated by two hydrazone groups and one carboxylate group. The compound is dimeric, with each unit consisting of two iron atoms (II) coordinated by two hydrazone groups and one carboxylate group. The compound exhibits ferromagnetic properties, being paramagnetic at room temperature. In crystallography studies, it was found that the 6-(hydroxymethyl)pyridine-2-carboxaldehyde adducts are tetranuclear with a helicate geometry around the Fe(II) atom. This compound is also paramagnetic at room temperature due to the presence of unpaired electrons on the two Fe(II) centers.

Formula: C₇H₇NO₂

Purity: Min. 99.8 Area-%

Color and Shape: White Off-White Powder

Molecular weight: 137.14 g/mol

Ref: 3D-FH54500

6-(Hydroxymethyl)picolinaldehyde

CAS: 39621-11-9

Formula: C₇H₇NO₂

Purity: 95%

Molecular weight: 137.138

Ref: 10-F237929