CAS 39627-61-7
:7-methyl-2,3-dihydro-1H-inden-1-one
Description:
7-Methyl-2,3-dihydro-1H-inden-1-one, with the CAS number 39627-61-7, is an organic compound characterized by its bicyclic structure, which includes a ketone functional group. This compound features a methyl group at the 7-position and a dihydroindene framework, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of the ketone group imparts reactivity, making it susceptible to nucleophilic attacks and enabling various chemical transformations. This compound is of interest in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or other fine chemicals. Its physical properties, such as boiling point and solubility, can vary based on the specific conditions and purity of the sample. Safety data should be consulted to handle this compound appropriately, as it may pose health risks if not managed correctly. Overall, 7-methyl-2,3-dihydro-1H-inden-1-one is a valuable compound in the field of organic chemistry.
Formula:C10H10O
InChI:InChI=1/C10H10O/c1-7-3-2-4-8-5-6-9(11)10(7)8/h2-4H,5-6H2,1H3
SMILES:Cc1cccc2CCC(=O)c12
Synonyms:- 1H-inden-1-one, 2,3-dihydro-7-methyl-
- 7-Methylindan-1-one
- 7-Methyl-1-Indanone
- 7-methyl-2,3-dihydroinden-1-one
- 7-Methyl-indan-1-one
- 1-Indanone-7-carboxylic acid
- 7-methlyindanone
- 7-methyl-2,3-dihydro-1H-inden-1-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
7-Methyl-2,3-dihydro-1H-inden-1-one
CAS:Formula:C10H10OPurity:98%Color and Shape:SolidMolecular weight:146.18587-Methyl-2,3-dihydroinden-1-one
CAS:7-Methyl-2,3-dihydroinden-1-onePurity:98%Molecular weight:146.19g/mol7-Methyl-1-indanone
CAS:Formula:C10H10OPurity:98%Color and Shape:No data available.Molecular weight:146.1897-Methyl-1-indanone
CAS:7-Methyl-1-indanone is a hydrogen chloride, which is a highly reactive chemical. It is an electrospray and particle that can be used in the manufacture of other compounds. 7-Methyl-1-indanone has been shown to have anti-tumour activity in vivo, inhibiting the growth of tumours by interfering with the topoisomerase and DNA synthesis. 7-Methyl-1-indanone also has antifungal properties and cytotoxic potency against humans cells. This compound is also an enantiopure aromatic compound with a chromophore that can be used as a starting material for other compounds.Formula:C10H10OPurity:Min. 95%Molecular weight:146.19 g/mol



