CAS 39630-46-1
:N-Glycyl-L-tyrosine dihydrate
Description:
N-Glycyl-L-tyrosine dihydrate is a dipeptide composed of the amino acids glycine and tyrosine, linked by a peptide bond. It is characterized by its molecular structure, which includes an amine group, a carboxylic acid group, and a phenolic hydroxyl group due to the presence of tyrosine. This compound is typically found as a dihydrate, meaning it incorporates two water molecules in its crystalline form, which can influence its solubility and stability. N-Glycyl-L-tyrosine dihydrate is soluble in water, making it suitable for various biochemical applications, including studies in protein synthesis and enzyme activity. Its properties may also be influenced by the presence of the hydroxyl group on the tyrosine residue, which can participate in hydrogen bonding and contribute to the compound's overall polarity. Additionally, this dipeptide may exhibit biological activities, such as antioxidant properties, due to the presence of tyrosine. Overall, N-Glycyl-L-tyrosine dihydrate is a compound of interest in both research and potential therapeutic applications.
Formula:C11H18N2O6
InChI:InChI=1/C11H14N2O4.2H2O/c12-6-10(15)13-9(11(16)17)5-7-1-3-8(14)4-2-7;;/h1-4,9,14H,5-6,12H2,(H,13,15)(H,16,17);2*1H2
SMILES:c1cc(ccc1CC(C(=O)O)N=C(CN)O)O.O.O
Synonyms:- Glycyltyrosine dihydrate
- Tyrosine, Glycyl-, Hydrate (1:2)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Glycyl-L-Tyrosine
CAS:Aromatic cyclic amides (including cyclic carbamates) and their derivatives; salts thereofFormula:C11H14N2O4·2H2OColor and Shape:PowderMolecular weight:238.09536Glycyl-L-Tyrosine Dihydrate
CAS:Controlled ProductApplications Glycyl-L-Tyrosine Dihydrate is used in process for producing N-Glycyltyrosine. Glycyl-L-Tyrosine Dihydrate is the anhydrous form of Glycyl-L-tyrosine(G720108); which is used in preparation method of high quality Aspartame and Aspartame crystallization-inducing agent.
References Mimura, T., et al.: Eur. Pat. Appl., (1999); Gao, Z., et al.: Faming Zhuanli Shenqing, (2019);Formula:C11H14N2O4·2H2OColor and Shape:NeatMolecular weight:274.27




