CAS 39632-84-3

3,4-Diethyl 1,2-dihydro-2-oxo-6-phenyl-3,4-pyridinedicarboxylate

Description:

3,4-Diethyl 1,2-dihydro-2-oxo-6-phenyl-3,4-pyridinedicarboxylate, with CAS number 39632-84-3, is a chemical compound that belongs to the class of pyridine derivatives. This substance typically exhibits a complex structure characterized by the presence of two ethyl groups, a phenyl group, and two carboxylate functionalities attached to a pyridine ring. The compound is likely to be a solid at room temperature and may have moderate solubility in organic solvents, depending on its specific molecular interactions. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the pyridine ring, which is often associated with biological activity. The compound may also exhibit interesting chemical reactivity due to the presence of the carbonyl and carboxylate groups, making it a candidate for further chemical transformations. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₇H₁₇NO₅

InChI: InChI=1S/C17H17NO5/c1-3-22-16(20)12-10-13(11-8-6-5-7-9-11)18-15(19)14(12)17(21)23-4-2/h5-10H,3-4H2,1-2H3,(H,18,19)

InChI key: InChIKey=XCBDFQUEXZKNON-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=C(C(OCC)=O)C(=O)NC(=C1)C2=CC=CC=C2

Synonyms:

• 2-Hydroxy-3,4-diethoxycarbonyl-6-phenyl-pyridine
• 3,4-Pyridinedicarboxylic acid, 1,2-dihydro-2-oxo-6-phenyl-, 3,4-diethyl ester
• 3,4-Diethyl 1,2-dihydro-2-oxo-6-phenyl-3,4-pyridinedicarboxylate
• 3,4-Pyridinedicarboxylic acid, 1,2-dihydro-2-oxo-6-phenyl-, diethyl ester