CAS 39635-10-4
:5-bromo-2-hydroxybenzohydrazide
Description:
5-Bromo-2-hydroxybenzohydrazide is an organic compound characterized by its hydrazide functional group and a bromine atom substituted on the aromatic ring. It features a hydroxyl group (-OH) at the ortho position relative to the hydrazide moiety, which contributes to its chemical reactivity and potential applications. The presence of the bromine atom enhances its electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. This compound is often utilized in the synthesis of pharmaceuticals, agrochemicals, and dyes due to its ability to form stable complexes with metal ions. Additionally, the hydroxyl group can participate in hydrogen bonding, influencing its solubility and interaction with biological systems. The compound's molecular structure allows for potential applications in medicinal chemistry, particularly in the development of antimicrobial or anti-inflammatory agents. As with many hydrazides, it may exhibit biological activity, warranting further investigation into its pharmacological properties. Safety data should be consulted before handling, as with all chemical substances.
Formula:C7H7BrN2O2
InChI:InChI=1/C7H7BrN2O2/c8-4-1-2-6(11)5(3-4)7(12)10-9/h1-3,11H,9H2,(H,10,12)
SMILES:c1cc(c(cc1Br)C(=NN)O)O
Synonyms:- Benzoic Acid, 5-Bromo-2-Hydroxy-, Hydrazide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
5-Bromosalicylhydrazide
CAS:<p>5-Bromosalicylhydrazide (5BSH) is a trivalent, magnetic metal coordination compound. The square planar geometry of the molecule is stabilized by metal ions in the middle of the plane and bivalent metal ions at the corners. 5BSH has been shown to be stable in aqueous solution with a pH range from 3 to 10 and has shown no significant change in its crystal structure or magnetic properties over this pH range. 5BSH also exhibits a transition from square planar to bivalent as the concentration of salt increases.</p>Formula:C7H7BrN2O2Purity:Min. 95%Color and Shape:PowderMolecular weight:231.05 g/mol
