CAS 39638-73-8
:5-Hydroxycytidine
Description:
5-Hydroxycytidine is a modified nucleoside that is derived from cytidine, featuring a hydroxyl group at the 5-position of the pyrimidine ring. This compound is characterized by its ability to participate in various biochemical processes, particularly in RNA metabolism and modification. It is known to play a role in the regulation of gene expression and can influence the stability and translation of RNA molecules. 5-Hydroxycytidine is often studied in the context of its potential therapeutic applications, including its effects on cellular processes and its role in the development of certain diseases. The compound is soluble in water and exhibits properties typical of nucleosides, such as the ability to form hydrogen bonds and participate in base pairing. Its structural modifications can affect its interaction with enzymes and other biomolecules, making it a subject of interest in both biochemical research and pharmaceutical development. Overall, 5-Hydroxycytidine represents an important area of study in the field of nucleic acid chemistry and molecular biology.
Formula:C9H13N3O6
InChI:InChI=1/C9H13N3O6/c10-7-3(14)1-12(9(17)11-7)8-6(16)5(15)4(2-13)18-8/h1,4-6,8,13-16H,2H2,(H2,10,11,17)/t4-,5-,6-,8-/m1/s1
InChI key:InChIKey=MPPUDRFYDKDPBN-UAKXSSHOSA-N
SMILES:O[C@H]1[C@@H](O[C@H](CO)[C@H]1O)N2C(=O)N=C(N)C(O)=C2
Synonyms:- Cytidine, 5-Hydroxy-
- 5-Hydroxycytidine
- Cytarabine Impurity 39
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
5-Hydroxycytidine
CAS:<p>5-Hydroxycytidine is a pyrimidine nucleoside that is found in DNA and RNA. It can be produced by the conversion of cytidine 5-monophosphate to cytidine 5'-diphosphate, which is then hydrolyzed to produce 5-hydroxycytidine. This conversion requires the enzyme cytidylate kinase. The structure of 5-hydroxycytidine differs from other pyrimidine nucleosides as its hydroxyl group does not have an acidic proton present. Biological functions that have been attributed to 5-hydroxydihydrocytidylic acid include its ability to inhibit translation and induce cell death in lung cells. This compound has also been shown to modify DNA duplexes and form bioconjugates with proteins or small molecules, such as fluorescein and digoxigenin. These modifications are used in analytical methods such as phase chromatography, nuclear magnetic resonance spectroscopy</p>Formula:C9H13N3O6Purity:Min. 95 Area-%Color and Shape:PowderMolecular weight:259.22 g/mol
