CAS 39640-62-5
:Pyridine-4-acetamide
Description:
Pyridine-4-acetamide, with the CAS number 39640-62-5, is an organic compound characterized by a pyridine ring substituted with an acetamide group at the 4-position. This compound typically appears as a white to off-white crystalline solid. It is soluble in polar solvents such as water and ethanol, owing to the presence of the amide functional group, which can engage in hydrogen bonding. Pyridine-4-acetamide exhibits basic properties due to the nitrogen atom in the pyridine ring, which can accept protons. The compound is of interest in various fields, including medicinal chemistry, where it may serve as a building block for the synthesis of pharmaceuticals or agrochemicals. Its structural features contribute to its potential biological activity, making it a subject of research for various applications. Additionally, like many nitrogen-containing heterocycles, it may exhibit unique reactivity patterns, making it valuable in organic synthesis. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C7H8N2O
InChI:InChI=1/C7H8N2O/c8-7(10)5-6-1-3-9-4-2-6/h1-4H,5H2,(H2,8,10)
SMILES:c1cnccc1CC(=N)O
Synonyms:- 2-(Pyridin-4-Yl)Acetamide
- 4-Pyridineacetamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-Pyridineacetamide, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C7H8N2OPurity:98%Color and Shape:White, Crystals or powder or crystalline powderMolecular weight:136.15Pyridine-4-Acetamide
CAS:Pyridine-4-Acetamide (4-Pyridineacetamide) is a pyridine-based ligand involved in the synthesis of W6S8 clusters.Formula:C7H8N2OPurity:99.99%Color and Shape:SolidMolecular weight:136.152-pyridin-4-ylacetamide
CAS:2-pyridin-4-ylacetamide is a chiral inorganic compound that can be synthesized by reacting 4-hydroxypyridine with 2,2'-diaminodiethylamine. The crystal structure of this compound has been determined using x-ray diffraction techniques. The molecule adopts a conformation that is twisted about the central C=N bond, which is typical for pyridines. It also has a significant amide proton resonance, which causes it to have an intense conformational dependence on the temperature and solvent.Formula:C7H8N2OPurity:Min. 95%Molecular weight:136.15 g/mol





