CAS 39642-60-9
:1,3-dipyridin-3-ylurea
Description:
1,3-Dipyridin-3-ylurea is an organic compound characterized by its urea functional group and two pyridine rings. It typically appears as a solid at room temperature and is soluble in polar solvents due to the presence of the urea moiety, which can engage in hydrogen bonding. The compound is known for its potential applications in medicinal chemistry, particularly as a scaffold for drug development, owing to the biological activity associated with pyridine derivatives. Its structure allows for various substitutions, which can influence its reactivity and interaction with biological targets. Additionally, 1,3-dipyridin-3-ylurea may exhibit properties such as moderate stability under standard conditions, but its reactivity can vary depending on the presence of functional groups and the specific environment. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled. Overall, this compound represents a significant interest in both synthetic and pharmaceutical chemistry.
Formula:C11H10N4O
InChI:InChI=1/C11H10N4O/c16-11(14-9-3-1-5-12-7-9)15-10-4-2-6-13-8-10/h1-8H,(H2,14,15,16)
SMILES:c1cc(cnc1)N=C(Nc1cccnc1)O
Synonyms:- urea, N,N'-di-3-pyridinyl-
- N,N-Dipyridin-3-Ylurea
- 1,3-Dipyridin-3-ylurea
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
N,N’-Bis(3-pyridyl)urea
CAS:Controlled Product<p>Applications N,N’-Bis(3-pyridyl)urea (cas# 39642-60-9) is a compound useful in organic synthesis.<br></p>Formula:C11H10N4OColor and Shape:NeatMolecular weight:214.22
