CAS 39643-31-7
:2-(1-Piperidinyl)aniline
Description:
2-(1-Piperidinyl)aniline, with the CAS number 39643-31-7, is an organic compound characterized by the presence of both an aniline and a piperidine moiety. This compound features a piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle, attached to the second position of an aniline structure, where an amino group (-NH2) is directly bonded to a benzene ring. The presence of the piperidine group contributes to its potential as a basic compound, influencing its solubility and reactivity. Typically, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The molecular structure allows for various interactions, including hydrogen bonding and potential participation in electrophilic aromatic substitution reactions. Additionally, the compound's properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and the presence of functional groups. Overall, 2-(1-Piperidinyl)aniline serves as a versatile building block in organic synthesis and pharmaceutical applications.
Formula:C11H16N2
InChI:InChI=1/C11H16N2/c12-10-6-2-3-7-11(10)13-8-4-1-5-9-13/h2-3,6-7H,1,4-5,8-9,12H2
SMILES:C1CCN(CC1)c1ccccc1N
Synonyms:- 2-(Piperidin-1-yl)aniline
- Benzenamine, 2-(1-piperidinyl)-
- N-(2-Aminophenyl)piperidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-(1-Piperidinyl)aniline, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C11H16N2Purity:98%Color and Shape:Crystals or powder or crystalline powder, Brown to dark brownMolecular weight:176.262-Piperidinoaniline
CAS:2-PiperidinoanilineFormula:C11H16N2Purity:≥95%Color and Shape: brown crystalsMolecular weight:176.25814g/mol2-(1-Piperidino)aniline
CAS:Controlled ProductApplications 2-(1-Piperidino)aniline is used to prepare oxalylarylaminobenzoic acids as inhibitors of protein tyrosine phosphatase 1B. It is also used to synthesize benzimidazole derivatives as AMP-activated protein kinase activators.
References Liu, G., et al.: J. Med. Chem., 46, 2093 (2003); Charton, J., et al.: Bioorg. Med. Chem., 14, 4490 (2006)Formula:C11H16N2Color and Shape:NeatMolecular weight:176.26




