CAS 39652-34-1

3,5-Dichloro-4-methylbenzoic acid

Description:

3,5-Dichloro-4-methylbenzoic acid is an aromatic carboxylic acid characterized by the presence of two chlorine atoms and a methyl group on a benzoic acid framework. Its molecular structure features a benzene ring substituted at the 3 and 5 positions with chlorine atoms and at the 4 position with a methyl group, contributing to its unique chemical properties. This compound is typically a white to off-white solid and is soluble in organic solvents, with limited solubility in water due to its hydrophobic aromatic structure. It exhibits acidic properties due to the carboxylic acid functional group, allowing it to participate in various chemical reactions, such as esterification and amidation. The presence of chlorine atoms enhances its reactivity and can influence its biological activity, making it of interest in pharmaceutical and agrochemical research. Additionally, 3,5-Dichloro-4-methylbenzoic acid may be used as an intermediate in the synthesis of other chemical compounds. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.

Formula: C₈H₆Cl₂O₂

InChI: InChI=1/C8H6Cl2O2/c1-4-6(9)2-5(8(11)12)3-7(4)10/h2-3H,1H3,(H,11,12)

SMILES: Cc1c(cc(cc1Cl)C(=O)O)Cl

Synonyms:

• Benzoic Acid, 3,5-Dichloro-4-Methyl-

3,5-Dichloro-4-Methylbenzoic Acid

CAS: 39652-34-1

Formula: C₈H₆Cl₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 205.0380

Ref: IN-DA00782O

3,5-Dichloro-4-methylbenzoic acid

CAS: 39652-34-1

3,5-Dichloro-4-methylbenzoic acid

Purity: 98%

Molecular weight: 205.04g/mol

Ref: 54-OR928502

3,5-Dichloro-4-methylbenzoic acid

CAS: 39652-34-1

3,5-Dichloro-4-methylbenzoic acid

Purity: 97%

Molecular weight: 205.04g/mol

Ref: 54-OR73884

3,5-Dichloro-4-methylbenzoic acid

CAS: 39652-34-1

Formula: C₈H₆Cl₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 205.03

Ref: 10-F092978