CAS 39658-49-6
:Methyl tetrahydro-2,5-dimethoxy-2-furancarboxylate
Description:
Methyl tetrahydro-2,5-dimethoxy-2-furancarboxylate, identified by its CAS number 39658-49-6, is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing oxygen. This compound features two methoxy groups (-OCH3) and a carboxylate ester functional group, contributing to its reactivity and solubility properties. It is typically a colorless to pale yellow liquid with a pleasant odor, making it potentially useful in flavor and fragrance applications. The presence of the tetrahydrofuran moiety suggests that it may exhibit moderate polarity, influencing its solubility in various organic solvents. Additionally, the methoxy groups can enhance the compound's stability and reactivity in chemical reactions, such as nucleophilic substitutions or esterifications. While specific toxicity data may not be widely available, compounds with similar structures should be handled with care, as they may pose health risks upon exposure. Overall, methyl tetrahydro-2,5-dimethoxy-2-furancarboxylate is of interest in both synthetic organic chemistry and potential industrial applications.
Formula:C8H14O5
InChI:InChI=1/C8H14O5/c1-10-6-4-5-8(12-3,13-6)7(9)11-2/h6H,4-5H2,1-3H3
InChI key:InChIKey=YUDUYCUJCQMCCJ-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1(OC)OC(OC)CC1
Synonyms:- 2-Furancarboxylic acid, tetrahydro-2,5-dimethoxy-, methyl ester
- 2-Furoic acid, tetrahydro-2,5-dimethoxy-, methyl ester
- 2-Methoxycarbonyl-2,5-dimethoxytetrahydrofuran
- Methyl 2,5-Dimethoxytetrahydrofuran-2-Carboxylate
- Methyl tetrahydro-2,5-dimethoxy-2-furancarboxylate
- Methyl tetrahydro-2,5-dimethoxy-2-furoate
- Methyl tetrahydro-2,5-dimethoxyfuroate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Methyl tetrahydro-2,5-dimethoxy-2-furancarboxylate
CAS:Methyl tetrahydro-2,5-dimethoxy-2-furancarboxylate is a sterically bulky molecule with a nitrogen atom in the ortho position. It has been used for the synthesis of various heterocyclic compounds. The steric bulk of methyl tetrahydro-2,5-dimethoxy-2-furancarboxylate prevents it from being substituted easily. This can be demonstrated by the refluxing of methyl tetrahydro-2,5-dimethoxy-2-furancarboxylate in benzene. The steric bulk also causes electron density to be distributed around methyl tetrahydro-2,5-dimethoxy-2-furancarboxylate, which creates a conjugated system.Formula:C8H14O5Purity:Min. 95%Color and Shape:Colourless To Pale Yellow Clear LiquidMolecular weight:190.19 g/mol
