CymitQuimica logo

CAS 39665-15-1

:

L-Cysteine, hydrate (1:1)

Description:
L-Cysteine, hydrate (1:1) is an amino acid that plays a crucial role in protein synthesis and is a precursor to the antioxidant glutathione. It is characterized by the presence of a thiol (-SH) group, which imparts reducing properties and contributes to its biochemical functions. The hydrate form indicates that the compound contains water molecules in its structure, which can influence its solubility and stability. L-Cysteine is typically a white crystalline powder, soluble in water, and has a slightly bitter taste. It is known for its role in various metabolic processes, including detoxification and the synthesis of keratin, making it important for skin, hair, and nail health. Additionally, L-Cysteine can act as a reducing agent in biochemical reactions, facilitating the formation and breaking of disulfide bonds in proteins. Its CAS number, 39665-15-1, is a unique identifier that helps in the classification and study of this compound in scientific literature and databases.
Formula:C3H7NO2S·H2O
InChI:InChI=1S/C3H7NO2S.H2O/c4-2(1-7)3(5)6;/h2,7H,1,4H2,(H,5,6);1H2/t2-;/m0./s1
InChI key:InChIKey=RIPZAYPXOPSKEE-DKWTVANSSA-N
SMILES:[C@@H](C(O)=O)(CS)N.O
Synonyms:
  • L-Cysteine, monohydrate
  • L-Cysteine, hydrate (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.