CAS 3968-19-2
:(-)-Reticuline
Description:
(-)-Reticuline is a naturally occurring alkaloid primarily found in various plant species, particularly within the Papaveraceae family. It is characterized by its complex bicyclic structure, which includes a phenolic and a methoxy group, contributing to its biological activity. This compound is known for its role as a precursor in the biosynthesis of other alkaloids, particularly in the pathway leading to morphine and other opiates. (-)-Reticuline exhibits various pharmacological properties, including analgesic and anti-inflammatory effects, making it of interest in medicinal chemistry. The compound is typically isolated from plant sources through extraction and purification processes. Its stereochemistry is significant, as the specific configuration influences its biological interactions and efficacy. In terms of solubility, (-)-Reticuline is generally soluble in organic solvents, which is common for many alkaloids. Research continues to explore its potential therapeutic applications and mechanisms of action, particularly in the context of pain management and other health-related fields.
Formula:C19H23NO4
InChI:InChI=1S/C19H23NO4/c1-20-7-6-13-10-19(24-3)17(22)11-14(13)15(20)8-12-4-5-18(23-2)16(21)9-12/h4-5,9-11,15,21-22H,6-8H2,1-3H3/t15-/m1/s1
InChI key:InChIKey=BHLYRWXGMIUIHG-OAHLLOKOSA-N
SMILES:C([C@@H]1C=2C(=CC(OC)=C(O)C2)CCN1C)C3=CC(O)=C(OC)C=C3
Synonyms:- (-)-Reticuline
- 7-Isoquinolinol, 1,2,3,4-tetrahydro-1-[(3-hydroxy-4-methoxyphenyl)methyl]-6-methoxy-2-methyl-, (1R)-
- L-Reticuline
- (1R)-1,2,3,4-Tetrahydro-1-[(3-hydroxy-4-methoxyphenyl)methyl]-6-methoxy-2-methyl-7-isoquinolinol
- 7-Isoquinolinol, 1,2,3,4-tetrahydro-1-[(3-hydroxy-4-methoxyphenyl)methyl]-6-methoxy-2-methyl-, (R)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
(R)-Reticuline
CAS:<p>(R)-Reticuline is a natural alkaloid that can be catalyzed by the microsomal P-450 system in plants and animals for conversion to Salutaridine.</p>Formula:C19H23NO4Purity:98%Color and Shape:SolidMolecular weight:329.39R-Reticuline
CAS:<p>R-Reticuline is a natural compound that has been shown to be an effective inhibitor of the enzyme cyclooxygenase-2 (COX-2). It binds to the active site of COX-2 and blocks the conversion of arachidonic acid to prostaglandin H2, thereby inhibiting inflammation. R-Reticuline can also inhibit other enzymes in the same family, such as lipooxygenase and 5-lipoxygenase. The COX-2 inhibition by R-Reticuline may be due to its ability to bind to a receptor on cells, which leads to inhibition of transcriptional activation.</p>Formula:C19H23NO4Purity:Min. 95%Color and Shape:PowderMolecular weight:329.39 g/mol

