CymitQuimica logo

CAS 39683-26-6

:

1H-Pyrazole-3-carboxylic acid, 4-hydroxy-1-(4-methoxyphenyl)-, ethylester

Description:
1H-Pyrazole-3-carboxylic acid, 4-hydroxy-1-(4-methoxyphenyl)-, ethyl ester, identified by CAS number 39683-26-6, is an organic compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a carboxylic acid functional group and an ethyl ester moiety, contributing to its reactivity and solubility properties. The presence of a hydroxy group and a methoxy-substituted phenyl group enhances its potential for hydrogen bonding and influences its biological activity. Typically, compounds of this nature may exhibit various pharmacological properties, making them of interest in medicinal chemistry. The molecular structure suggests potential applications in drug development, particularly in areas targeting specific biological pathways. Additionally, the compound's stability, solubility in organic solvents, and reactivity with other functional groups are important characteristics that can influence its utility in synthetic chemistry and pharmaceutical formulations.
Formula:C13H14N2O4
InChI:InChI=1S/C13H14N2O4/c1-3-19-13(17)12-11(16)8-15(14-12)9-4-6-10(18-2)7-5-9/h4-8,16H,3H2,1-2H3
InChI key:DEAWYDZTIUXURF-UHFFFAOYSA-N
SMILES:CCOC(=O)C1=NN(C=C1O)C2=CC=C(C=C2)OC
Found 4 products.