CymitQuimica logo

CAS 39685-81-9

:

N-(2-furylmethoxy)phthalimide

Description:
N-(2-furylmethoxy)phthalimide is an organic compound characterized by its unique structure, which includes a phthalimide moiety and a furylmethoxy group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential applications in various fields, including pharmaceuticals and materials science. It is generally soluble in organic solvents, reflecting its non-polar characteristics, while its stability under standard conditions makes it suitable for various chemical reactions. The presence of the furyl group may impart specific reactivity, particularly in electrophilic substitution reactions, while the phthalimide structure can participate in nucleophilic reactions. Additionally, this compound may exhibit biological activity, making it of interest for medicinal chemistry. Its synthesis often involves the reaction of phthalimide derivatives with furylmethanol or related compounds, highlighting its relevance in synthetic organic chemistry. Overall, N-(2-furylmethoxy)phthalimide is a versatile compound with potential utility in diverse chemical applications.
Formula:C13H9NO4
InChI:InChI=1/C13H9NO4/c15-12-10-5-1-2-6-11(10)13(16)14(12)18-8-9-4-3-7-17-9/h1-7H,8H2
SMILES:c1ccc2c(c1)C(=O)N(C2=O)OCc1ccco1
Synonyms:
  • 2-(furan-2-ylmethoxy)-1H-isoindole-1,3(2H)-dione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.