CAS 3969-59-3
:1,2:3,4:5,6-tri-O-isopropylidene-D-mannitol
Description:
1,2:3,4:5,6-Tri-O-isopropylidene-D-mannitol is a chemical compound that serves as a protective derivative of D-mannitol, a sugar alcohol. This compound is characterized by the presence of three isopropylidene groups, which are acetal protecting groups that enhance the stability and solubility of the molecule. The isopropylidene groups shield the hydroxyl functionalities of D-mannitol, making it less reactive and more suitable for various synthetic applications. The compound is typically a white to off-white crystalline solid, and it is soluble in organic solvents such as dichloromethane and methanol, while being less soluble in water due to the bulky protecting groups. Its structure allows for selective deprotection, enabling the regeneration of D-mannitol under specific conditions. This compound is often utilized in organic synthesis, particularly in carbohydrate chemistry, where it aids in the manipulation of sugar derivatives. Additionally, it may have applications in pharmaceuticals and biochemistry, where controlled reactivity is essential.
Formula:C15H26O6
InChI:InChI=1/C15H26O6/c1-13(2)16-7-9(18-13)11-12(21-15(5,6)20-11)10-8-17-14(3,4)19-10/h9-12H,7-8H2,1-6H3/t9-,10-,11-,12-/m1/s1
SMILES:CC1(C)OC[C@H]([C@@H]2[C@@H]([C@H]3COC(C)(C)O3)OC(C)(C)O2)O1
Synonyms:- 2,2,2',2',2'',2''-Hexamethyl-4,4':5',4''-Ter-1,3-Dioxolane (Non-Preferred Name)
- (4R,4'R,4''R,5'R)-2,2,2',2',2'',2''-hexamethyl-4,4':5',4''-ter-1,3-dioxolane (non-preferred name)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
(4R,4'R,4''R,5'R)-2,2,2',2',2'',2''-Hexamethyl-4,4':5',4''-ter(1,3-dioxolane)
CAS:Formula:C15H26O6Molecular weight:302.36331,2:3,4:5,6-Tri-O-isopropylidene-D-mannitol
CAS:1,2:3,4:5,6-Tri-O-isopropylidene-D-mannitol is a dietary fiber that is made up of inulin and oligosaccharides. It can be found in various plants and vegetables. This dietary fiber has been shown to have cancer preventive properties. 1,2:3,4:5,6-Tri-O-isopropylidene-D-mannitol has also been shown to decrease the risk of colon cancer by reducing the production of diacylglycerol which is an important signaling molecule in carcinogenesis.Formula:C15H26O6Purity:Min. 95%Molecular weight:302.4 g/mol

