CAS 39698-00-5
:[(2S,3R,4S,5S,6S)-3,5,6-triacetoxy-4-allyloxy-tetrahydropyran-2-yl]methyl acetate
Description:
The chemical substance with the name "[(2S,3R,4S,5S,6S)-3,5,6-triacetoxy-4-allyloxy-tetrahydropyran-2-yl]methyl acetate" and CAS number 39698-00-5 is a complex organic compound characterized by its tetrahydropyran ring structure, which is a six-membered cyclic ether. This compound features multiple acetoxy groups, which are indicative of its potential reactivity and solubility properties, as acetoxy groups can enhance the compound's ability to participate in various chemical reactions. The presence of an allyloxy group suggests that it may undergo further transformations, such as polymerization or substitution reactions. The stereochemistry, denoted by the (2S,3R,4S,5S,6S) configuration, indicates specific spatial arrangements of the atoms, which can significantly influence the compound's biological activity and interactions. Overall, this compound may have applications in organic synthesis, medicinal chemistry, or as an intermediate in the production of more complex molecules. Its specific properties, such as solubility, melting point, and reactivity, would need to be determined through experimental analysis.
Formula:C17H24O10
InChI:InChI=1/C17H24O10/c1-6-7-22-15-14(24-10(3)19)13(8-23-9(2)18)27-17(26-12(5)21)16(15)25-11(4)20/h6,13-17H,1,7-8H2,2-5H3/t13-,14+,15-,16-,17+/m0/s1
Synonyms:- 1,2,4,6-Tetra-O-acetyl-3-O-allyl-α-L-gulopyranose
- α-L-gulopyranose, 3-O-2-propen-1-yl-, tetraacetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1,2,4,6-Tetra-o-acetyl-3-o-allyl-β-d-glucopyranose
CAS:Formula:C17H24O10Purity:98%Color and Shape:SolidMolecular weight:388.36651,2,4,6-Tetra-O-acetyl-3-O-allyl-β-D-glucopyranose
CAS:Formula:C17H24O10Purity:>98.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:388.371,2,4,6-Tetra-O-acetyl-3-O-allyl-β-D-glucopyranose
CAS:1,2,4,6-Tetra-O-acetyl-3-O-allyl-β-D-glucopyranosePurity:>98%Molecular weight:388.37g/mol1,2,4,6-Tetra-O-acetyl-3-O-allyl-b-D-glucopyranose
CAS:1,2,4,6-Tetra-O-acetyl-3-O-allyl-b-D-glucopyranose is a high purity and custom synthesis compound. It is a synthetic monosaccharide with CAS number 39698-00-5. This product is methylated at the C1 and C6 positions. It can be used to modify natural or synthetic oligosaccharides and polysaccharides by click chemistry. The complex carbohydrate has also been fluorinated at the C2 position.
Formula:C17H24O10Purity:Min. 95%Molecular weight:388.37 g/mol





