CAS 397-28-4
:3′-(Trifluoromethyl)[1,1′-biphenyl]-4-amine
Description:
3′-(Trifluoromethyl)[1,1′-biphenyl]-4-amine, with the CAS number 397-28-4, is an organic compound characterized by the presence of a biphenyl structure substituted with a trifluoromethyl group and an amino group. This compound features a biphenyl backbone, which consists of two phenyl rings connected by a single bond, enhancing its stability and contributing to its aromatic properties. The trifluoromethyl group (-CF3) is known for its electron-withdrawing effects, which can significantly influence the compound's reactivity and solubility. The amino group (-NH2) introduces basicity and potential for hydrogen bonding, making the compound useful in various chemical reactions, including nucleophilic substitutions. Additionally, the presence of fluorine atoms can enhance lipophilicity and alter the compound's biological activity. Overall, this compound is of interest in fields such as medicinal chemistry and materials science due to its unique structural features and potential applications.
Formula:C13H10F3N
InChI:InChI=1S/C13H10F3N/c14-13(15,16)11-3-1-2-10(8-11)9-4-6-12(17)7-5-9/h1-8H,17H2
InChI key:InChIKey=XREKLJQACWAWSV-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=C(C=CC1)C2=CC=C(N)C=C2
Synonyms:- 3'-(Trifluoromethyl)biphenyl-4-amine hydrochloride (1:1)
- 3′-(Trifluoromethyl)[1,1′-biphenyl]-4-amine
- 4-Amino-3′-trifluoromethyl-1,1′-biphenyl
- 4-Biphenylamine, 3′-(trifluoromethyl)-
- Cd 3-3030
- [1,1'-Biphenyl]-4-amine, 3'-(trifluoromethyl)-, hydrochloride (1:1)
- [1,1′-Biphenyl]-4-amine, 3′-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
4-[3-(Trifluoromethyl)phenyl]aniline
CAS:<p>4-[3-(Trifluoromethyl)phenyl]aniline</p>Molecular weight:237.22041g/mol



