CAS 397-50-2
:3-(trifluoromethyl)-10H-phenothiazine
Description:
3-(Trifluoromethyl)-10H-phenothiazine is a chemical compound characterized by its phenothiazine backbone, which consists of a sulfur atom and a nitrogen atom within a three-ring structure. The presence of a trifluoromethyl group (-CF3) at the 3-position significantly influences its chemical properties, enhancing its lipophilicity and potentially affecting its biological activity. This compound is typically a solid at room temperature and exhibits a distinct color, often associated with its aromatic structure. It is known for its applications in various fields, including pharmaceuticals and materials science, due to its ability to interact with biological systems and its stability under certain conditions. The trifluoromethyl group can also impart unique electronic properties, making it a subject of interest in synthetic chemistry and drug development. Safety data indicates that, like many fluorinated compounds, it should be handled with care, as it may pose environmental and health risks. Overall, 3-(trifluoromethyl)-10H-phenothiazine is a versatile compound with significant implications in both research and industry.
Formula:C13H8F3NS
InChI:InChI=1/C13H8F3NS/c14-13(15,16)8-5-6-10-12(7-8)18-11-4-2-1-3-9(11)17-10/h1-7,17H
SMILES:c1ccc2c(c1)Nc1ccc(cc1S2)C(F)(F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
3-(Trifluoromethyl)-10H-phenothiazine
CAS:Controlled ProductFormula:C13H8F3NSColor and Shape:NeatMolecular weight:267.269

