CAS 397-57-9

2-fluorophenazine

Description:

2-Fluorophenazine is an organic compound characterized by its structure, which consists of a phenazine core with a fluorine atom substituted at the second position of one of the phenyl rings. This compound typically exhibits a planar structure due to the conjugated system of the phenazine, which can influence its electronic properties and reactivity. 2-Fluorophenazine is known for its potential applications in organic electronics, such as in the development of organic semiconductors and dyes, owing to its ability to participate in charge transfer processes. The presence of the fluorine atom can enhance the compound's stability and alter its solubility compared to non-fluorinated analogs. Additionally, 2-fluorophenazine may exhibit interesting photophysical properties, making it a subject of interest in materials science and photochemistry. As with many fluorinated compounds, it is essential to handle 2-fluorophenazine with care, considering its potential toxicity and environmental impact.

Formula: C₁₂H₇FN₂

InChI: InChI=1/C12H7FN2/c13-8-5-6-11-12(7-8)15-10-4-2-1-3-9(10)14-11/h1-7H

SMILES: c1ccc2c(c1)nc1ccc(cc1n2)F

Synonyms:

• Phenazine, 2-fluoro-

2-Fluorophenazine

CAS: 397-57-9

2-Fluorophenazine

Formula: C₁₂H₇FN₂

Purity: ≥95%

Color and Shape: grey solid

Molecular weight: 198.20g/mol

Ref: 54-PC57774