CAS 3970-28-3
:5-methylthiophene-2-thiol
Description:
5-Methylthiophene-2-thiol is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic ring containing sulfur. The presence of a methyl group at the 5-position and a thiol (-SH) functional group at the 2-position contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid with a distinct odor, often associated with sulfur-containing compounds. It is soluble in organic solvents and exhibits moderate stability under standard conditions. The thiol group makes it a potential candidate for various chemical reactions, including oxidation and substitution reactions, and it can participate in the formation of disulfides. Additionally, 5-methylthiophene-2-thiol may have applications in the synthesis of pharmaceuticals, agrochemicals, and as a flavoring agent due to its characteristic aroma. Safety precautions should be observed when handling this compound, as thiols can be irritating and have strong odors.
Formula:C5H6S2
InChI:InChI=1/C5H6S2/c1-4-2-3-5(6)7-4/h2-3,6H,1H3
SMILES:Cc1ccc(S)s1
Synonyms:- 2-Thiophenethiol, 5-methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
5-Methylthiophene-2-thiol
CAS:<p>5-Methylthiophene-2-thiol is a mercaptan with a thiol group at the 5 position. The sulfur atom in the thiol group is electron deficient and can serve as an electron donor. This compound has been used in food chemistry to make a diacetyl-free butter flavor. It has also been studied for its ability to inhibit the expansion of polystyrene foam. Mercaptans are found in fossil fuels, but are also produced synthetically by alkylation of hydrocarbons with hydrogen sulfide. The term "mercaptan" was coined by combining the words "mercury" and "sulfur." <br>Mercaptans are functionally important because they have both an alkylthio group and a mercapto group, which allow them to act as both an acid and an alcohol. 5-Methylthiophene-2-thiol can be used for many applications such as detergents, textile d</p>Formula:C5H6S2Purity:Min. 95%Molecular weight:130.2 g/mol
