CAS 3971-54-8
:(+/-)-cis-9,10-methyleneoctadecanoic*acid methyl
Description:
The chemical substance known as "(+/-)-cis-9,10-methyleneoctadecanoic acid methyl" with the CAS number 3971-54-8 is a fatty acid derivative characterized by its long hydrocarbon chain and the presence of a methylene group in its structure. This compound features a cis configuration at the 9 and 10 positions, which influences its physical properties, such as melting point and solubility. The methyl ester form indicates that it is an esterified fatty acid, which typically enhances its volatility and reactivity compared to the free acid. This substance is likely to exhibit amphiphilic properties, making it useful in various applications, including surfactants and emulsifiers. Additionally, the presence of the methylene group can affect its biological activity and interactions with other molecules. Overall, its unique structural features contribute to its potential utility in both industrial and biochemical contexts.
Formula:C20H38O2
InChI:InChI=1/C20H38O2/c1-3-4-5-6-8-11-14-18-17-19(18)15-12-9-7-10-13-16-20(21)22-2/h18-19H,3-17H2,1-2H3
Synonyms:- Cyclopropaneoctanoic acid, 2-octyl-, methyl ester, cis-
- Methyl 2-octylcyclopropaneoctanoate cis-
- methyl 8-[(1S,2R)-2-octylcyclopropyl]octanoate
- Methyl 8-(2-Octylcyclopropyl)Octanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Methyl cis-9,10-Methyleneoctadecanoate
CAS:Formula:C20H38O2Purity:>98%Color and Shape:LiquidMolecular weight:310.52Methyl 9(R),10(S)-Methyleneoctadecanoate
CAS:Formula:C20H38O2Purity:>98%Color and Shape:LiquidMolecular weight:310.51cis-9,10-Methyleneoctadecanoic Acid methyl ester
CAS:Cis-9,10-Methyleneoctadecanoic acid methyl ester, a cyclopropane fatty acid methyl ester, stimulates DNA synthesis in rat hepatocytes and serves as a standard for quantifying cis-9,10-methyleneoctadecanoic acid in bacterial membranes through co-chromatography. [Matreya, LLC. Catalog No. 1823]Formula:C20H38O2Color and Shape:SolidMolecular weight:310.522


