CAS 3972-64-3
:1-Bromo-3-tert-butylbenzene
Description:
1-Bromo-3-tert-butylbenzene is an organic compound characterized by the presence of a bromine atom and a tert-butyl group attached to a benzene ring. Its molecular structure consists of a benzene ring substituted at the 3-position with a tert-butyl group (a branched alkyl group) and at the 1-position with a bromine atom. This compound is typically a colorless to pale yellow liquid with a distinctive aromatic odor. It is relatively non-polar, making it soluble in organic solvents but less so in water. The presence of the bromine atom introduces reactivity, allowing for various chemical transformations, such as nucleophilic substitution reactions. The tert-butyl group contributes to steric hindrance, influencing the compound's reactivity and stability. 1-Bromo-3-tert-butylbenzene is used in organic synthesis and as an intermediate in the production of other chemical compounds. Safety precautions should be observed when handling this substance, as it may pose health risks if inhaled or ingested.
Formula:C10H13Br
InChI:InChI=1/C10H13Br/c1-10(2,3)8-5-4-6-9(11)7-8/h4-7H,1-3H3
SMILES:CC(C)(C)c1cccc(c1)Br
Synonyms:- 3-Tert-Butylbromobenzene
- Benzene, 1-bromo-3-(1,1-dimethylethyl)-
- 1-Bromo-3-(tert-Butyl)benzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Bromo-3-tert-butylbenzene
CAS:Formula:C10H13BrPurity:95%Color and Shape:LiquidMolecular weight:213.1142Ref: IN-DA0038RL
1g20.00€5g28.00€10g46.00€1kgTo inquire25g73.00€5kgTo inquire100g211.00€500gTo inquire1-Bromo-3-(tert-butyl)benzene
CAS:1-Bromo-3-(tert-butyl)benzeneFormula:C10H13BrPurity:98%Color and Shape: clear. almost colourless liquidMolecular weight:213.11g/mol1-Bromo-3-tert-butylbenzene
CAS:Formula:C10H13BrPurity:95%Color and Shape:Liquid, Low Melting SolidMolecular weight:213.1181-Bromo-3-tert-butylbenzene
CAS:<p>1-Bromo-3-tert-butylbenzene is a chemical compound that is used in the synthesis of pharmaceuticals, pesticides, and other organic compounds. It has been shown to be an effective inhibitor of NF-κB, which plays a key role in the inflammatory response. 1-Bromo-3-tert-butylbenzene has also been shown to inhibit colon cancer cells and phosphatase activity. The inhibition of these two activities can lead to a decrease in human diseases such as cancer and diabetes. This compound can be synthesized by using solvents such as dichloromethane or chloroform, or by using phosphatase enzymes from bacteria or fungi.</p>Formula:C10H13BrPurity:Min. 95%Molecular weight:213.11 g/mol



