CymitQuimica logo

CAS 397283-49-7

:

4-(4-bromophenyl)-2,5-dimethyl-1,3-thiazole

Description:
4-(4-Bromophenyl)-2,5-dimethyl-1,3-thiazole is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features a bromophenyl group, indicating the presence of a bromine atom attached to a phenyl ring, which contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The two methyl groups on the thiazole ring enhance its lipophilicity, potentially influencing its biological activity and solubility. The presence of the bromine atom can also affect the compound's electronic properties, making it a candidate for further study in medicinal chemistry. Additionally, the thiazole moiety is known for its diverse biological activities, including antimicrobial and antifungal properties. Overall, this compound's unique structural features suggest it may have significant utility in research and development within the chemical and pharmaceutical industries.
Formula:C11H10BrNS
InChI:InChI=1/C11H10BrNS/c1-7-11(13-8(2)14-7)9-3-5-10(12)6-4-9/h3-6H,1-2H3
SMILES:Cc1c(c2ccc(cc2)Br)nc(C)s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.