CAS 3973-08-8
:thiazole-4-carboxylic acid
Description:
Thiazole-4-carboxylic acid is a heterocyclic organic compound characterized by the presence of a thiazole ring, which is a five-membered ring containing both sulfur and nitrogen atoms. This compound features a carboxylic acid functional group (-COOH) at the 4-position of the thiazole ring, contributing to its acidic properties. Thiazole-4-carboxylic acid is typically a white to off-white crystalline solid, and it is soluble in polar solvents such as water and alcohols, which is common for carboxylic acids. The compound exhibits various chemical reactivity due to the presence of both the thiazole ring and the carboxylic acid group, making it useful in organic synthesis and as a building block in the development of pharmaceuticals and agrochemicals. Additionally, thiazole derivatives are known for their biological activities, including antimicrobial and antifungal properties. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C4H2NO2S
InChI:InChI=1/C4H3NO2S/c6-4(7)3-1-8-2-5-3/h1-2H,(H,6,7)/p-1
SMILES:c1c(C(=O)[O-])ncs1
Synonyms:- 4-Thiazolecarboxylic acid
- 1,3-Thiazole-4-carboxylic acid
- Thiazole-4-Caxboxylicacid
- 1,3-Thiazole-4-Carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Thiazole-4-carboxylic Acid
CAS:Formula:C4H3NO2SPurity:>98.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:129.13Thiazole-4-carboxylic acid
CAS:Formula:C4H3NO2SPurity:97%Color and Shape:SolidMolecular weight:129.13711,3-Thiazole-4-carboxylic acid
CAS:1,3-Thiazole-4-carboxylic acidFormula:C4H3NO2SPurity:≥95%Color and Shape: off-white solidMolecular weight:129.14g/mol1,3-Thiazole-4-carboxylic acid
CAS:1,3-Thiazole-4-carboxylic acid is a chemical compound that has many applications in the research field. It is a reactant in organic chemistry and can be used as a building block for complex compounds. 1,3-Thiazole-4-carboxylic acid also serves as an intermediate for the production of pharmaceuticals and fine chemicals. This chemical is not listed on the Chemical Abstract Service (CAS) registry, but it is available for purchase from Chemical Solutions at low cost.Formula:C4H3NO2SPurity:Min. 95%Color and Shape:PowderMolecular weight:129.14 g/mol1,3-Thiazole-4-carboxylic acid
CAS:Formula:C4H3NO2SPurity:97%Color and Shape:SolidMolecular weight:129.134-Thiazolecarboxylic Acid
CAS:Controlled ProductApplications 4-Thiazolecarboxylic Acid (cas# 3973-08-8) is a compound useful in organic synthesis.
Formula:C4H3NO2SColor and Shape:NeatMolecular weight:129.14






