CAS 39731-05-0
:1-Methylethyl 4-[3-[(1,1-dimethylethyl)amino]-2-hydroxypropoxy]-1H-indole-2-carboxylate
Description:
1-Methylethyl 4-[3-[(1,1-dimethylethyl)amino]-2-hydroxypropoxy]-1H-indole-2-carboxylate, with CAS number 39731-05-0, is a chemical compound that belongs to the class of indole derivatives. This substance features a complex structure characterized by an indole ring, which is a bicyclic structure consisting of a benzene ring fused to a pyrrole ring. The presence of a carboxylate group indicates that it can participate in various chemical reactions, including esterification and acid-base reactions. The compound also contains a hydroxypropoxy group, which may enhance its solubility and reactivity. The tert-butyl amino group suggests potential biological activity, as amines are often involved in interactions with biological targets. Overall, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its specific characteristics, such as solubility, stability, and reactivity, would depend on the surrounding conditions and the presence of other functional groups.
Formula:C19H28N2O4
InChI:InChI=1S/C19H28N2O4/c1-12(2)25-18(23)16-9-14-15(21-16)7-6-8-17(14)24-11-13(22)10-20-19(3,4)5/h6-9,12-13,20-22H,10-11H2,1-5H3
InChI key:InChIKey=SJYFDORQYYEJLB-UHFFFAOYSA-N
SMILES:O(CC(CNC(C)(C)C)O)C1=C2C(NC(C(OC(C)C)=O)=C2)=CC=C1
Synonyms:- (±)-Sdz 21009
- 1-Methylethyl 4-[3-[(1,1-dimethylethyl)amino]-2-hydroxypropoxy]-1H-indole-2-carboxylate
- 1H-Indole-2-carboxylic acid, 4-[3-[(1,1-dimethylethyl)amino]-2-hydroxypropoxy]-, 1-methylethyl ester
- Carpindolol [INN]
- Isopropyl (+-)-4-(3-(tert-butylamino)-2-hydroxypropoxy)indole-2-carboxylate
- Lm 21009
- Sandoz 21-009
- Unii-W8F97Xp38W
- propan-2-yl 4-[3-(tert-butylamino)-2-hydroxypropoxy]-1H-indole-2-carboxylate
- Carpindolol


