CAS 3975-77-7

1-bromo-2,4,6-tri-tert-butylbenzene

Description:

1-Bromo-2,4,6-tri-tert-butylbenzene is an organic compound characterized by its aromatic structure, featuring a benzene ring substituted with three tert-butyl groups and one bromine atom. The presence of the bulky tert-butyl groups significantly influences its physical and chemical properties, contributing to its low solubility in polar solvents and high solubility in nonpolar solvents. This compound typically exhibits a high melting point and boiling point due to the steric hindrance provided by the tert-butyl groups, which also enhance its stability and hinder electrophilic substitution reactions. The bromine substituent can participate in nucleophilic substitution reactions, making it a useful intermediate in organic synthesis. Additionally, the compound's structure imparts significant steric bulk, which can affect its reactivity and interactions with other molecules. Overall, 1-bromo-2,4,6-tri-tert-butylbenzene serves as an important compound in synthetic organic chemistry, particularly in the development of more complex molecular architectures.

Formula: C₁₈H₂₉Br

InChI: InChI=1/C18H29Br/c1-16(2,3)12-10-13(17(4,5)6)15(19)14(11-12)18(7,8)9/h10-11H,1-9H3

SMILES: CC(C)(C)c1cc(c(c(c1)C(C)(C)C)Br)C(C)(C)C

Synonyms:

• 2,4,6-Tri-t-butyl-1-bromobenzene
• 2-Bromo-1,3,5-Tri-Tert-Butylbenzene
• 2,4,6-Tri-tert-butylbromobenzene
• 1-Bromo-2,4,6-Tri(tert-butyl)benzene

2-Bromo-1,3,5-tri-tert-butylbenzene

CAS: 3975-77-7

Formula: C₁₈H₂₉Br

Purity: 96%

Color and Shape: Solid

Molecular weight: 325.3269

Ref: IN-DA0032P8

2-Bromo-1,3,5-tri-tert-butylbenzene

CAS: 3975-77-7

2-Bromo-1,3,5-tri-tert-butylbenzene

Purity: 97%

Molecular weight: 325.33g/mol

Ref: 54-OR73254

2-Bromo-1,3,5-tri-tert-butylbenzene

CAS: 3975-77-7

Formula: C₁₈H₂₉Br

Purity: 95%

Color and Shape: Solid

Molecular weight: 325.334

Ref: 10-F213414