CAS 39754-64-8
:Tetrahydro-6-(phenoxymethyl)-2H-1,3-oxazine-2-thione
Description:
Tetrahydro-6-(phenoxymethyl)-2H-1,3-oxazine-2-thione, with the CAS number 39754-64-8, is a chemical compound characterized by its unique oxazine ring structure, which incorporates both sulfur and oxygen in its functional groups. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the thione group, which can participate in various chemical reactions. The phenoxymethyl substituent may enhance its solubility and reactivity, making it of interest in medicinal chemistry and organic synthesis. Additionally, compounds of this nature can exhibit diverse pharmacological properties, including antimicrobial or anti-inflammatory activities, although specific biological data would depend on empirical studies. Its stability, reactivity, and potential applications in drug development or as a synthetic intermediate would be influenced by the electronic and steric effects of the substituents on the oxazine ring. As with many chemical substances, safety data and handling precautions should be reviewed before use in laboratory or industrial settings.
Formula:C11H13NO2S
InChI:InChI=1S/C11H13NO2S/c15-11-12-7-6-10(14-11)8-13-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,12,15)
InChI key:InChIKey=NIPRGEWHJUTVQK-UHFFFAOYSA-N
SMILES:C(OC1=CC=CC=C1)C2OC(=S)NCC2
Synonyms:- 2H-1,3-Oxazine-2-thione, 3,4,5,6-tetrahydro-6-phenoxymethyl-
- 2H-1,3-Oxazine-2-thione, 6-phenoxymethyl-3,4,5,6-tetrahydro-
- 2H-1,3-Oxazine-2-thione, tetrahydro-6-(phenoxymethyl)-
- 6-(Phenoxymethyl)-1,3-Oxazinane-2-Thione
- 6-Phenoxymethyl-3,4,5,6-tetrahydro-2H-1,3-oxazine-2-thione
- Brn 0517442
- Phenoxymethyl-6 tetrahydroxazine-1,3 thione-2
- Tetrahydro-6-(phenoxymethyl)-2H-1,3-oxazine-2-thione
- Tifemoxona
- Tifemoxona [INN-Spanish]
- Tifemoxone [INN]
- Tifemoxonum
- Tifemoxonum [INN-Latin]
- Unii-09I93Hj3Y4
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
6-(Phenoxymethyl)-1,3-oxazinane-2-thione
CAS:6-Phenoxymethyl-1,3-oxazinane-2-thione is a potent drug candidate that has been shown to bind to the target site of the disease and inhibit its growth. 6-Phenoxymethyl-1,3-oxazinane-2-thione is insoluble in water and has a high concentration of active compound. The drug can be injected or implanted as a treatment for many diseases. 6-Phenoxymethyl-1,3-oxazinane-2-thione binds to the target site by iontophoresis, which means that it is delivered into the body from an external source using an electric current. This drug will be used as a diagnostic agent for implanting devices that are made out of hydrophobic materials such as silicon or plastic.Formula:C11H13NO2SPurity:Min. 95%Molecular weight:223.29 g/mol
