CymitQuimica logo

CAS 39773-45-0

:

(3R)-3-(carbamoylamino)-3-(4-chlorophenyl)propanoate

Description:
The chemical substance known as (3R)-3-(carbamoylamino)-3-(4-chlorophenyl)propanoate, with the CAS number 39773-45-0, is an amino acid derivative characterized by the presence of a carbamoylamino group and a 4-chlorophenyl moiety. This compound features a chiral center at the propanoate backbone, indicating that it exists in a specific stereoisomeric form, which can influence its biological activity and interactions. The presence of the carbamoyl group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as it may enhance solubility and bioavailability. The 4-chlorophenyl group can also contribute to the compound's lipophilicity and may play a role in receptor binding or enzyme interactions. Overall, the structural features of this compound suggest it may have relevance in various biochemical pathways, and its unique characteristics could be explored for therapeutic purposes. Further studies would be necessary to fully elucidate its properties and potential applications in research and medicine.
Formula:C10H10ClN2O3
InChI:InChI=1/C10H11ClN2O3/c11-7-3-1-6(2-4-7)8(5-9(14)15)13-10(12)16/h1-4,8H,5H2,(H,14,15)(H3,12,13,16)/p-1/t8-/m1/s1
SMILES:c1cc(ccc1[C@@H](CC(=O)[O-])NC(=N)O)Cl
Found 1 products.