CAS 39773-47-2
:Benzenepropanoic acid, b-amino-4-bromo-
Description:
Benzenepropanoic acid, b-amino-4-bromo- is an organic compound characterized by its aromatic benzene ring and a propanoic acid functional group. The presence of a b-amino group indicates that there is an amino group (-NH2) attached to the carbon chain, specifically at the beta position relative to the carboxylic acid group. The compound also features a bromine atom substituted at the para position of the benzene ring, which can influence its reactivity and physical properties. This substitution can enhance the compound's electrophilic character and may affect its solubility in various solvents. Typically, compounds of this nature can exhibit biological activity, making them of interest in pharmaceutical and chemical research. The molecular structure suggests potential applications in synthesis and as intermediates in the production of more complex molecules. Safety and handling considerations are essential, as with many brominated compounds, due to potential toxicity and environmental impact.
Formula:C9H10BrNO2
InChI:InChI:1S/C9H10BrNO2/c10-7-3-1-6(2-4-7)8(11)5-9(12)13/h1-4,8H,5,11H2,(H,12,13)
Synonyms:- Dl-3-Amino-3-(4-Bromophenyl)Propionic Acid
- (Rs)-Beta-Amino-Beta-(4-Bromophenyl)Propionic Acid
- 3-Amino-3-(4-bromophenyl)propionic acid
- 3-Amino-3-(4-bromophenyl)propanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Amino-3-(4-bromophenyl)propionic acid
CAS:Formula:C9H10BrNO2Purity:95%Color and Shape:SolidMolecular weight:244.08523-Amino-3-(4-bromophenyl)propanoic acid
CAS:3-Amino-3-(4-bromophenyl)propanoic acidPurity:95%Color and Shape:White SolidMolecular weight:244.09g/molDL-ß-(p-Bromophenyl)alanine
CAS:Formula:C9H10BrNO2Purity:98%Color and Shape:SolidMolecular weight:244.0883-Amino-3-(4-bromophenyl)propanoic acid
CAS:3-Amino-3-(4-bromophenyl)propanoic acid is a versatile building block that is used in the synthesis of many different compounds. It is a reagent, useful as a research chemical and as a speciality chemical. 3-Amino-3-(4-bromophenyl)propanoic acid has been used in the synthesis of a number of complex compounds, including pharmaceuticals and pesticides. This compound is a good choice for use in organic synthesis because it reacts readily with an array of functional groups, such as carboxylic acids and amines.Formula:C9H10BrNO2Purity:Min. 95%Color and Shape:PowderMolecular weight:244.09 g/molRef: 3D-FA140126
Discontinued product



