CAS 39774-28-2
:6-Phenyl-2-pyridinecarboxylic acid
Description:
6-Phenyl-2-pyridinecarboxylic acid, identified by its CAS number 39774-28-2, is an organic compound characterized by a pyridine ring substituted with a carboxylic acid group and a phenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including stability and potential for various chemical reactions. It is likely to be a solid at room temperature, with moderate solubility in polar solvents due to the presence of the carboxylic acid functional group. The compound may participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Its structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Additionally, the presence of both the phenyl and pyridine moieties may impart unique electronic properties, making it of interest in materials science and medicinal chemistry. As with many organic compounds, safety data should be consulted for handling and usage, as it may pose health risks if not managed properly.
Formula:C12H9NO2
InChI:InChI=1/C12H9NO2/c14-12(15)11-8-4-7-10(13-11)9-5-2-1-3-6-9/h1-8H,(H,14,15)
SMILES:c1ccc(cc1)c1cccc(C(=O)O)n1
Synonyms:- 6-Phenylpyridine-2-carboxylic acid
- 6-Phenylpicolinic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
6-Phenylpyridine-2-carboxylic Acid
CAS:Formula:C12H9NO2Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:199.216-Phenylpyridine-2-carboxylic acid
CAS:Formula:C12H9NO2Purity:95%Color and Shape:SolidMolecular weight:199.20546-Phenylpyridine-2-carboxylic acid
CAS:6-Phenylpyridine-2-carboxylic acidFormula:C12H9NO2Purity:≥95%Color and Shape:SolidMolecular weight:199.21g/mol6-Phenylpyridine-2-carboxylic acid
CAS:Formula:C12H9NO2Purity:98%Color and Shape:SolidMolecular weight:199.2096-Phenylpyridine-2-carboxylic Acid
CAS:Controlled ProductApplications 6-Phenylpyridine-2-carboxylic Acid is used in the preparation of inhibitors acting upon 2-Oxoglutarate-dependant nucleic acid demethylase, involved in nucleic acid repairs and modifications.
References Woon, E. et al.: J. Med. Chem., 55, 2173 (2012);Formula:C12H9NO2Color and Shape:NeatMolecular weight:199.21




