CAS 39779-23-2

1-(3,5-dimethoxyphenyl)-1H-pyrrole

Description:

1-(3,5-Dimethoxyphenyl)-1H-pyrrole is an organic compound characterized by its pyrrole ring, which is a five-membered aromatic heterocycle containing nitrogen. The presence of the 3,5-dimethoxyphenyl group indicates that two methoxy (-OCH3) substituents are attached to the phenyl ring at the 3 and 5 positions, enhancing the compound's electron-donating properties. This substitution pattern can influence the compound's reactivity, solubility, and overall stability. The pyrrole moiety contributes to the compound's aromaticity and potential biological activity, making it of interest in medicinal chemistry and organic synthesis. The compound may exhibit various physical properties, such as a specific melting point and solubility in organic solvents, which are typical for similar aromatic compounds. Additionally, its structure suggests potential applications in the development of pharmaceuticals or as a building block in organic synthesis due to the functional groups present. Overall, 1-(3,5-dimethoxyphenyl)-1H-pyrrole is a versatile compound with unique characteristics stemming from its molecular structure.

Formula: C₁₂H₁₃NO₂

InChI: InChI=1/C12H13NO2/c1-14-11-7-10(8-12(9-11)15-2)13-5-3-4-6-13/h3-9H,1-2H3

SMILES: COc1cc(cc(c1)OC)n1cccc1

1-(3,5-Dimethoxyphenyl)-1H-pyrrole

CAS: 39779-23-2

1-(3,5-Dimethoxyphenyl)-1H-pyrrole

Purity: 95

Molecular weight: 203.24g/mol

Ref: 54-OR46703