CAS 397843-67-3
:4-(N-Isopropylaminocarbonyl)phenylboronic acid
Description:
4-(N-Isopropylaminocarbonyl)phenylboronic acid is an organic compound characterized by the presence of a boronic acid functional group attached to a phenyl ring, which is further substituted with an isopropylaminocarbonyl group. This compound typically exhibits properties such as being a white to off-white solid, with moderate solubility in polar solvents like water and alcohols, owing to the presence of both hydrophobic and hydrophilic groups. The boronic acid moiety allows for the formation of reversible covalent bonds with diols, making it useful in various applications, including drug development and as a reagent in organic synthesis. Additionally, the isopropylamino group can influence the compound's biological activity and solubility. The compound's structure suggests potential interactions with biological targets, which may be explored in medicinal chemistry. Safety data should be consulted for handling and usage, as boronic acids can have specific reactivity and toxicity profiles. Overall, this compound represents a versatile building block in both synthetic and medicinal chemistry.
Formula:C10H14BNO3
InChI:InChI=1/C10H14BNO3/c1-7(2)12-10(13)8-3-5-9(6-4-8)11(14)15/h3-7,14-15H,1-2H3,(H,12,13)
SMILES:CC(C)NC(=O)c1ccc(cc1)B(O)O
Synonyms:- [4-(Isopropylcarbamoyl)phenyl]boronic acid
- boronic acid, B-[4-[[(1-methylethyl)amino]carbonyl]phenyl]-
- {4-[(1-Methylethyl)Carbamoyl]Phenyl}Boronic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-(N-Isopropylaminocarbonyl)phenylboronic acid
CAS:Formula:C10H14BNO3Purity:98%Color and Shape:SolidMolecular weight:207.03414-(Isopropylcarbamoyl)benzeneboronic acid
CAS:4-(Isopropylcarbamoyl)benzeneboronic acidFormula:C10H14BNO3Purity:98%Color and Shape: white solidMolecular weight:207.03g/mol(4-(Isopropylcarbamoyl)phenyl)boronic acid
CAS:Formula:C10H14BNO3Purity:98%Color and Shape:SolidMolecular weight:207.044-(Isopropylcarbamoyl)benzeneboronic acid, 95%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C10H14BNO3Purity:95%Molecular weight:207.04



