CAS 39786-35-1
:Ethyl 3-aminobenzo[b]furan-2-carboxylate
Description:
Ethyl 3-aminobenzo[b]furan-2-carboxylate is a chemical compound characterized by its unique structure, which includes a furan ring fused to a benzene ring, along with an ethyl ester and an amino group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the amino group. The ethyl ester functional group contributes to its solubility in organic solvents and may influence its reactivity in various chemical reactions, such as esterification or amidation. Additionally, the presence of the amino group can facilitate hydrogen bonding and enhance its biological activity, making it of interest in medicinal chemistry. The compound may also exhibit fluorescence properties due to its conjugated system, which can be useful in various applications, including dye synthesis or as a fluorescent probe. Overall, Ethyl 3-aminobenzo[b]furan-2-carboxylate is a versatile compound with potential applications in pharmaceuticals and materials science.
Formula:C11H11NO3
InChI:InChI=1/C11H11NO3/c1-2-14-11(13)10-9(12)7-5-3-4-6-8(7)15-10/h3-6H,2,12H2,1H3
SMILES:CCOC(=O)c1c(c2ccccc2o1)N
Synonyms:- 2-Benzofurancarboxylic Acid, 3-Amino-, Ethyl Ester
- Ethyl 3-amino-1-benzofuran-2-carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Ethyl 3-Aminobenzofuran-2-carboxylate
CAS:Formula:C11H11NO3Purity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:205.21Ethyl 3-aminobenzo[b]furan-2-carboxylate, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C11H11NO3Purity:97%Color and Shape:White, Crystals or powder or crystalline powderMolecular weight:205.21Ethyl 3-aminobenzofuran-2-carboxylate
CAS:Formula:C11H11NO3Purity:98%Color and Shape:SolidMolecular weight:205.2099Ethyl 3-aminobenzofuran-2-carboxylate
CAS:Ethyl 3-aminobenzofuran-2-carboxylatePurity:99%Molecular weight:205.21g/molEthyl 3-aminobenzofuran-2-carboxylate
CAS:Ethyl 3-aminobenzofuran-2-carboxylate is a decarboxylated pyridine derivative that has been shown to react with an aldoxime to form an unsymmetrical aldehyde. This reaction is catalyzed by acid and alkaline hydrolysis. It is also able to form benzothiophenes and benzofurans through the same reaction. Ethyl 3-aminobenzofuran-2-carboxylate can be used in the synthesis of many other organic compounds, including phenacyl, carboxylic acids, pyridines, and aryl halides.Formula:C11H11NO3Purity:Min. 95%Molecular weight:205.21 g/mol





