CymitQuimica logo

CAS 39786-40-8

:

4-chloro-2-methyl[1]benzofuro[3,2-d]pyrimidine

Description:
4-Chloro-2-methyl[1]benzofuro[3,2-d]pyrimidine is a heterocyclic compound characterized by its fused ring structure, which incorporates both benzofuran and pyrimidine moieties. This compound features a chlorine atom and a methyl group attached to the benzofuro-pyrimidine framework, influencing its chemical reactivity and potential biological activity. It is typically a crystalline solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the chloro and methyl substituents can affect its electronic properties, making it of interest in medicinal chemistry and material science. Compounds of this type may demonstrate various biological activities, including antimicrobial or anticancer properties, although specific biological data would depend on empirical studies. Its unique structure allows for potential applications in drug development and as a building block in organic synthesis. As with many heterocycles, the stability and reactivity of 4-chloro-2-methyl[1]benzofuro[3,2-d]pyrimidine can be influenced by environmental factors such as pH and temperature.
Formula:C11H7ClN2O
InChI:InChI=1/C11H7ClN2O/c1-6-13-9-7-4-2-3-5-8(7)15-10(9)11(12)14-6/h2-5H,1H3
InChI key:GXGXMTZNONDUMY-UHFFFAOYSA-N
SMILES:Cc1nc2c3ccccc3oc2c(Cl)n1
Synonyms:
  • 4-Chloro-2-methyl-benzo[4,5]furo[3,2-d]pyrimidine
  • Benzofuro[3,2-d]pyrimidine, 4-chloro-2-methyl-
  • 4-Chloro-2-methyl[1]benzofuro[3,2-d]pyrimidine
Found 4 products.