CAS 39787-83-2

2-Methoxy-4-nitrobenzoyl chloride

Description:

2-Methoxy-4-nitrobenzoyl chloride is an organic compound characterized by its functional groups, including a benzoyl chloride moiety and a methoxy and nitro substituent on the aromatic ring. This compound typically appears as a yellow to orange solid or liquid, depending on its purity and form. It is known for its reactivity, particularly due to the presence of the acyl chloride functional group, which makes it a useful intermediate in organic synthesis, especially in the preparation of various derivatives through acylation reactions. The nitro group contributes to its electrophilic character, while the methoxy group can influence its electronic properties and solubility. 2-Methoxy-4-nitrobenzoyl chloride is generally handled with care due to its potential irritant effects and reactivity with water, which can lead to the release of hydrochloric acid. As with many organic compounds, proper safety protocols should be followed when working with this substance in a laboratory setting.

Formula: C₈H₆ClNO₄

InChI: InChI=1S/C8H6ClNO4/c1-14-7-4-5(10(12)13)2-3-6(7)8(9)11/h2-4H,1H3

InChI key: InChIKey=DJDAPLBWGIXUAG-UHFFFAOYSA-N

SMILES: O(C)C1=C(C(Cl)=O)C=CC(N(=O)=O)=C1

Synonyms:

• 2-Methoxy-4-nitrobenzoyl chloride
• Benzoyl chloride, 2-methoxy-4-nitro-