CAS 39793-31-2
:4H-thieno[3,2-b]pyrrole-5-carboxylic acid
Description:
4H-thieno[3,2-b]pyrrole-5-carboxylic acid is a heterocyclic organic compound characterized by its unique fused ring structure, which includes both a thieno and pyrrole moiety. This compound typically exhibits properties such as being a solid at room temperature and having moderate solubility in polar solvents due to the presence of the carboxylic acid functional group. The carboxylic acid group contributes to its acidity and potential for forming hydrogen bonds, which can influence its reactivity and interactions with other molecules. Additionally, the compound may exhibit interesting electronic properties due to the conjugated system formed by the thieno and pyrrole rings, making it of interest in organic electronics and materials science. Its structural features may also impart biological activity, making it a candidate for further research in medicinal chemistry. Overall, 4H-thieno[3,2-b]pyrrole-5-carboxylic acid is a versatile compound with potential applications in various fields, including organic synthesis and pharmaceuticals.
Formula:C7H5NO2S
InChI:InChI=1/C7H5NO2S/c9-7(10)5-3-6-4(8-5)1-2-11-6/h1-3,8H,(H,9,10)
SMILES:c1csc2cc(C(=O)O)[nH]c12
Synonyms:- 4-Thieno[3,2-b]pyrrole-5-carboxylic acid
- CHEMBRDG-BB 4012315
- 4H-THIENO[3,2-B]PYRROLE-5-CARBOXYLIC ACID
- 4H-thieno[3,2-b]pyrrole-5-carboxylic acid(SALTDATA: FREE)
- D-Amino Acid Oxidase Inhibitor
- Thieno[2,3-b]pyrrole-5-carboxylic acid
- D-Amino Acid Oxidase Inhibitor - CAS 39793-31-2 - Calbiochem
- 4H-thieno[2,3-d]pyrrole-5-carboxylic acid
- AKOS BB-9991
- 79793-31-2
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4H-Thieno[3,2-b]pyrrole-5-carboxylic acid, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C7H5NO2SPurity:97%Molecular weight:167.194H-Thieno[3,2-b]pyrrole-5-carboxylic acid
CAS:Formula:C7H5NO2SPurity:97%Color and Shape:SolidMolecular weight:167.18514H-Thieno[3,2-b]pyrrole-5-carboxylic acid
CAS:4H-Thieno[3,2-b]pyrrole-5-carboxylic acidPurity:98%Molecular weight:167.19g/mol4H-Thieno[3,2-b]pyrrole-5-carboxylic acid
CAS:Formula:C7H5NO2SPurity:97%Color and Shape:SolidMolecular weight:167.18



